NPs Basic Information
|
Name |
3,4,5-trihydroxy-1-tetralone
|
| Molecular Formula | C10H10O4 | |
| IUPAC Name* |
3,4,5-trihydroxy-3,4-dihydro-2H-naphthalen-1-one
|
|
| SMILES |
O=C1CC(O)C(O)c2c(O)cccc21
|
|
| InChI |
InChI=1S/C10H10O4/c11-6-3-1-2-5-7(12)4-8(13)10(14)9(5)6/h1-3,8,10-11,13-14H,4H2/t8-,10+/m1/s1
|
|
| InChIKey |
QOVAQJFUUCNXQE-SCZZXKLOSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 194.19 | ALogp: | 0.4 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 77.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 14 | QED Weighted: | 0.57 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.973 | MDCK Permeability: | 0.00000748 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.006 |
| Human Intestinal Absorption (HIA): | 0.335 | 20% Bioavailability (F20%): | 0.117 |
| 30% Bioavailability (F30%): | 0.967 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.813 | Plasma Protein Binding (PPB): | 37.79% |
| Volume Distribution (VD): | 0.943 | Fu: | 65.29% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.064 | CYP1A2-substrate: | 0.099 |
| CYP2C19-inhibitor: | 0.035 | CYP2C19-substrate: | 0.263 |
| CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.855 |
| CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.313 |
| CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.165 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 7.363 | Half-life (T1/2): | 0.669 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.061 |
| Drug-inuced Liver Injury (DILI): | 0.319 | AMES Toxicity: | 0.339 |
| Rat Oral Acute Toxicity: | 0.558 | Maximum Recommended Daily Dose: | 0.012 |
| Skin Sensitization: | 0.139 | Carcinogencity: | 0.121 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.443 |
| Respiratory Toxicity: | 0.13 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005843 |  |
0.652 | D0H6QU |  |
0.284 | ||
| ENC003267 |  |
0.652 | D07HBX |  |
0.275 | ||
| ENC002593 |  |
0.652 | D05SHK |  |
0.256 | ||
| ENC004790 |  |
0.652 | D07MGA |  |
0.253 | ||
| ENC005067 |  |
0.652 | D0H1AR |  |
0.245 | ||
| ENC006140 |  |
0.583 | D01WJL |  |
0.241 | ||
| ENC005720 |  |
0.574 | D0C4YC |  |
0.241 | ||
| ENC002432 |  |
0.574 | D0V9EN |  |
0.237 | ||
| ENC004399 |  |
0.520 | D03GET |  |
0.233 | ||
| ENC004398 |  |
0.520 | D00IUG |  |
0.231 | ||