![]() |
Name |
leporine B
|
Molecular Formula | C21H28O | |
IUPAC Name* |
3-benzyl-4,5-dimethyl-1-prop-1-enyl-4a,5,6,7,8,8a-hexahydro-1H-isochromene
|
|
SMILES |
CC=CC1OC(Cc2ccccc2)=C(C)C2C(C)CCCC12
|
|
InChI |
InChI=1S/C21H28O/c1-4-9-19-18-13-8-10-15(2)21(18)16(3)20(22-19)14-17-11-6-5-7-12-17/h4-7,9,11-12,15,18-19,21H,8,10,13-14H2,1-3H3/b9-4+/t15-,18+,19+,21-/m1/s1
|
|
InChIKey |
PPOJYJKOBVXSKP-QPMHVRJOSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.45 | ALogp: | 5.5 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 9.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.648 |
Caco-2 Permeability: | -4.584 | MDCK Permeability: | 0.00001030 |
Pgp-inhibitor: | 0.025 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.026 |
30% Bioavailability (F30%): | 0.034 |
Blood-Brain-Barrier Penetration (BBB): | 0.472 | Plasma Protein Binding (PPB): | 97.68% |
Volume Distribution (VD): | 2.522 | Fu: | 1.32% |
CYP1A2-inhibitor: | 0.491 | CYP1A2-substrate: | 0.562 |
CYP2C19-inhibitor: | 0.862 | CYP2C19-substrate: | 0.673 |
CYP2C9-inhibitor: | 0.815 | CYP2C9-substrate: | 0.329 |
CYP2D6-inhibitor: | 0.774 | CYP2D6-substrate: | 0.124 |
CYP3A4-inhibitor: | 0.934 | CYP3A4-substrate: | 0.777 |
Clearance (CL): | 13.515 | Half-life (T1/2): | 0.08 |
hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.08 |
Drug-inuced Liver Injury (DILI): | 0.68 | AMES Toxicity: | 0.044 |
Rat Oral Acute Toxicity: | 0.436 | Maximum Recommended Daily Dose: | 0.3 |
Skin Sensitization: | 0.056 | Carcinogencity: | 0.076 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.043 |
Respiratory Toxicity: | 0.073 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004959 | ![]() |
0.552 | D03RZV | ![]() |
0.303 | ||
ENC001728 | ![]() |
0.319 | D0G1OZ | ![]() |
0.280 | ||
ENC000825 | ![]() |
0.307 | D0U0RZ | ![]() |
0.274 | ||
ENC001970 | ![]() |
0.307 | D0L1WV | ![]() |
0.273 | ||
ENC004822 | ![]() |
0.307 | D0T6SU | ![]() |
0.272 | ||
ENC005484 | ![]() |
0.307 | D0P6UB | ![]() |
0.270 | ||
ENC001087 | ![]() |
0.307 | D06PSS | ![]() |
0.270 | ||
ENC005971 | ![]() |
0.307 | D05OIS | ![]() |
0.265 | ||
ENC004861 | ![]() |
0.304 | D05BMG | ![]() |
0.264 | ||
ENC002419 | ![]() |
0.286 | D0T3LF | ![]() |
0.264 |