![]() |
Name |
guignardianone G
|
Molecular Formula | C18H22O6 | |
IUPAC Name* |
3-hydroxybutan-2-yl4-benzylidene-5-oxo-2-propan-2-yl-1,3-dioxolane-2-carboxylate
|
|
SMILES |
CC(O)C(C)OC(=O)C1(C(C)C)OC(=O)C(=Cc2ccccc2)O1
|
|
InChI |
InChI=1S/C18H22O6/c1-11(2)18(17(21)22-13(4)12(3)19)23-15(16(20)24-18)10-14-8-6-5-7-9-14/h5-13,19H,1-4H3/b15-10-/t12-,13+,18-/m0/s1
|
|
InChIKey |
FZDYDRCCPGQMTO-LSGMUICRSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 334.37 | ALogp: | 2.3 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 82.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.658 |
Caco-2 Permeability: | -4.801 | MDCK Permeability: | 0.00002990 |
Pgp-inhibitor: | 0.984 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.998 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.322 | Plasma Protein Binding (PPB): | 92.28% |
Volume Distribution (VD): | 1.735 | Fu: | 4.00% |
CYP1A2-inhibitor: | 0.257 | CYP1A2-substrate: | 0.254 |
CYP2C19-inhibitor: | 0.384 | CYP2C19-substrate: | 0.794 |
CYP2C9-inhibitor: | 0.438 | CYP2C9-substrate: | 0.07 |
CYP2D6-inhibitor: | 0.021 | CYP2D6-substrate: | 0.111 |
CYP3A4-inhibitor: | 0.418 | CYP3A4-substrate: | 0.546 |
Clearance (CL): | 6.3 | Half-life (T1/2): | 0.494 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.497 |
Drug-inuced Liver Injury (DILI): | 0.96 | AMES Toxicity: | 0.034 |
Rat Oral Acute Toxicity: | 0.028 | Maximum Recommended Daily Dose: | 0.014 |
Skin Sensitization: | 0.626 | Carcinogencity: | 0.531 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.023 |
Respiratory Toxicity: | 0.019 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003270 | ![]() |
0.739 | D01ZJK | ![]() |
0.297 | ||
ENC002130 | ![]() |
0.696 | D06IXT | ![]() |
0.291 | ||
ENC003616 | ![]() |
0.426 | D03KOZ | ![]() |
0.281 | ||
ENC006094 | ![]() |
0.369 | D0L1WV | ![]() |
0.281 | ||
ENC002126 | ![]() |
0.311 | D0RA5Q | ![]() |
0.278 | ||
ENC002586 | ![]() |
0.303 | D00BLL | ![]() |
0.278 | ||
ENC000888 | ![]() |
0.302 | D03QJL | ![]() |
0.276 | ||
ENC001091 | ![]() |
0.297 | D0D4YZ | ![]() |
0.273 | ||
ENC003076 | ![]() |
0.296 | D0LG8E | ![]() |
0.273 | ||
ENC000637 | ![]() |
0.295 | D00HHS | ![]() |
0.273 |