![]() |
Name |
Metacytofilin
|
Molecular Formula | C16H22N2O4 | |
IUPAC Name* |
(3R,6R)-3-benzyl-3-hydroxy-6-(methylamino)-6-(2-methylpropyl)morpholine-2,5-dione
|
|
SMILES |
CC(C)C[C@@]1(C(=O)N[C@](C(=O)O1)(CC2=CC=CC=C2)O)NC
|
|
InChI |
InChI=1S/C16H22N2O4/c1-11(2)9-16(17-3)13(19)18-15(21,14(20)22-16)10-12-7-5-4-6-8-12/h4-8,11,17,21H,9-10H2,1-3H3,(H,18,19)/t15-,16-/m1/s1
|
|
InChIKey |
DPVKIQKSCWSCBE-HZPDHXFCSA-N
|
|
Synonyms |
Metacytofilin; 145398-57-8; (3R,6R)-3-benzyl-3-hydroxy-6-(methylamino)-6-(2-methylpropyl)morpholine-2,5-dione; trans-3-Hydroxy-6-(methylamino)-6-(2-methylpropyl)-3-(phenylmethyl)-2,5-morpholinedione; DTXSID90932583; 2,5-Morpholinedione, 3-hydroxy-6-(methylamino)-6-(2-methylpropyl)-3-(phenylmethyl)-, trans-; 3-alpha-hydroxy-6beta-methylamino-6alpha-(2-methylpropyl)-3beta-phenylmethyl-4H-2,3,5,6-tetrahydro-1,4-oxazine-2,5-dione; 3-Benzyl-3,5-dihydroxy-6-(methylamino)-6-(2-methylpropyl)-3,6-dihydro-2H-1,4-oxazin-2-one
|
|
CAS | 145398-57-8 | |
PubChem CID | 132718 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 306.36 | ALogp: | 1.7 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 22 | QED Weighted: | 0.705 |
Caco-2 Permeability: | -5.011 | MDCK Permeability: | 0.00007860 |
Pgp-inhibitor: | 0.024 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.032 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.029 |
Blood-Brain-Barrier Penetration (BBB): | 0.961 | Plasma Protein Binding (PPB): | 72.98% |
Volume Distribution (VD): | 2.262 | Fu: | 40.29% |
CYP1A2-inhibitor: | 0.056 | CYP1A2-substrate: | 0.208 |
CYP2C19-inhibitor: | 0.092 | CYP2C19-substrate: | 0.834 |
CYP2C9-inhibitor: | 0.075 | CYP2C9-substrate: | 0.334 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.184 |
CYP3A4-inhibitor: | 0.155 | CYP3A4-substrate: | 0.913 |
Clearance (CL): | 8.303 | Half-life (T1/2): | 0.765 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.164 |
Drug-inuced Liver Injury (DILI): | 0.227 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.026 | Maximum Recommended Daily Dose: | 0.932 |
Skin Sensitization: | 0.19 | Carcinogencity: | 0.009 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
Respiratory Toxicity: | 0.052 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001909 | ![]() |
0.395 | D0P6UB | ![]() |
0.358 | ||
ENC001970 | ![]() |
0.383 | D07RGW | ![]() |
0.333 | ||
ENC004822 | ![]() |
0.383 | D0G1OZ | ![]() |
0.329 | ||
ENC002255 | ![]() |
0.375 | D0RA5Q | ![]() |
0.322 | ||
ENC004869 | ![]() |
0.340 | D0T3LF | ![]() |
0.313 | ||
ENC000214 | ![]() |
0.333 | D05BMG | ![]() |
0.313 | ||
ENC002130 | ![]() |
0.333 | D08UMH | ![]() |
0.313 | ||
ENC003270 | ![]() |
0.322 | D0U5RT | ![]() |
0.313 | ||
ENC001904 | ![]() |
0.321 | D0Z9NZ | ![]() |
0.313 | ||
ENC002521 | ![]() |
0.321 | D0Y7RW | ![]() |
0.305 |