|
Name |
Ueckerchalasin E
|
Molecular Formula | C30H39NO5 | |
IUPAC Name* |
(16-benzyl-5,6-dihydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl)acetate
|
|
SMILES |
CC(=O)OC1C=CC(C)(O)C(O)C(C)CC=CC2C=C(C)C(C)C3C(Cc4ccccc4)NC(=O)C213
|
|
InChI |
InChI=1S/C30H39NO5/c1-18-10-9-13-23-16-19(2)20(3)26-24(17-22-11-7-6-8-12-22)31-28(34)30(23,26)25(36-21(4)32)14-15-29(5,35)27(18)33/h6-9,11-16,18,20,23-27,33,35H,10,17H2,1-5H3,(H,31,34)/b13-9+,15-14+/t18-,20+,23-,24-,25+,26-,27+,29-,30+/m0/s1
|
|
InChIKey |
WNRLWCXSKKYWAW-CILUEWGHSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 493.64 | ALogp: | 3.7 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 95.9 | Aromatic Rings: | 4 |
Heavy Atoms: | 36 | QED Weighted: | 0.428 |
Caco-2 Permeability: | -4.842 | MDCK Permeability: | 0.00003330 |
Pgp-inhibitor: | 0.694 | Pgp-substrate: | 0.101 |
Human Intestinal Absorption (HIA): | 0.125 | 20% Bioavailability (F20%): | 0.014 |
30% Bioavailability (F30%): | 0.013 |
Blood-Brain-Barrier Penetration (BBB): | 0.951 | Plasma Protein Binding (PPB): | 94.63% |
Volume Distribution (VD): | 1.686 | Fu: | 5.63% |
CYP1A2-inhibitor: | 0.024 | CYP1A2-substrate: | 0.118 |
CYP2C19-inhibitor: | 0.142 | CYP2C19-substrate: | 0.633 |
CYP2C9-inhibitor: | 0.176 | CYP2C9-substrate: | 0.118 |
CYP2D6-inhibitor: | 0.098 | CYP2D6-substrate: | 0.155 |
CYP3A4-inhibitor: | 0.904 | CYP3A4-substrate: | 0.558 |
Clearance (CL): | 4.901 | Half-life (T1/2): | 0.047 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.034 |
Drug-inuced Liver Injury (DILI): | 0.297 | AMES Toxicity: | 0.034 |
Rat Oral Acute Toxicity: | 0.516 | Maximum Recommended Daily Dose: | 0.292 |
Skin Sensitization: | 0.015 | Carcinogencity: | 0.028 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.938 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001922 | 0.815 | D06CWH | 0.269 | ||||
ENC004444 | 0.800 | D0E9KA | 0.266 | ||||
ENC005441 | 0.798 | D01TSI | 0.261 | ||||
ENC005440 | 0.737 | D0V3ZA | 0.254 | ||||
ENC005439 | 0.735 | D0SP3D | 0.254 | ||||
ENC005442 | 0.703 | D0TB8C | 0.248 | ||||
ENC004468 | 0.664 | D0D7KC | 0.248 | ||||
ENC004026 | 0.653 | D09NNH | 0.247 | ||||
ENC004541 | 0.650 | D0W7RJ | 0.246 | ||||
ENC002261 | 0.639 | D0R1BD | 0.246 |