|
Name |
[(1S,2R,3E,5R,7S,9E,11S,14S,15R,16S)-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate
|
Molecular Formula | C30H39NO4 | |
IUPAC Name* |
[(1S,2R,3E,5R,7S,9E,11S,14S,15R,16S)-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate
|
|
SMILES |
C[C@H]1C/C=C/[C@H]2C=C([C@H]([C@@H]3[C@@]2([C@@H](/C=C/[C@](C1)(C)O)OC(=O)C)C(=O)N[C@H]3CC4=CC=CC=C4)C)C
|
|
InChI |
InChI=1S/C30H39NO4/c1-19-10-9-13-24-16-20(2)21(3)27-25(17-23-11-7-6-8-12-23)31-28(33)30(24,27)26(35-22(4)32)14-15-29(5,34)18-19/h6-9,11-16,19,21,24-27,34H,10,17-18H2,1-5H3,(H,31,33)/b13-9+,15-14+/t19-,21+,24-,25-,26+,27-,29-,30+/m0/s1
|
|
InChIKey |
LYHWACCLUSDGME-HTGZJUKKSA-N
|
|
Synonyms |
RKS-1778; CHEMBL517485; [(1S,2R,3E,5R,7S,9E,11S,14S,15R,16S)-16-Benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate
|
|
CAS | NA | |
PubChem CID | 9847900 | |
ChEMBL ID | CHEMBL517485 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 477.6 | ALogp: | 4.5 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 75.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 35 | QED Weighted: | 0.464 |
Caco-2 Permeability: | -5.086 | MDCK Permeability: | 0.00001710 |
Pgp-inhibitor: | 0.766 | Pgp-substrate: | 0.988 |
Human Intestinal Absorption (HIA): | 0.48 | 20% Bioavailability (F20%): | 0.055 |
30% Bioavailability (F30%): | 0.013 |
Blood-Brain-Barrier Penetration (BBB): | 0.749 | Plasma Protein Binding (PPB): | 93.21% |
Volume Distribution (VD): | 1.165 | Fu: | 3.20% |
CYP1A2-inhibitor: | 0.11 | CYP1A2-substrate: | 0.118 |
CYP2C19-inhibitor: | 0.919 | CYP2C19-substrate: | 0.612 |
CYP2C9-inhibitor: | 0.898 | CYP2C9-substrate: | 0.136 |
CYP2D6-inhibitor: | 0.591 | CYP2D6-substrate: | 0.148 |
CYP3A4-inhibitor: | 0.944 | CYP3A4-substrate: | 0.305 |
Clearance (CL): | 3.721 | Half-life (T1/2): | 0.114 |
hERG Blockers: | 0.314 | Human Hepatotoxicity (H-HT): | 0.753 |
Drug-inuced Liver Injury (DILI): | 0.224 | AMES Toxicity: | 0.263 |
Rat Oral Acute Toxicity: | 0.651 | Maximum Recommended Daily Dose: | 0.982 |
Skin Sensitization: | 0.311 | Carcinogencity: | 0.072 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.977 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004542 | 0.815 | D06CWH | 0.273 | ||||
ENC004444 | 0.815 | D01TSI | 0.272 | ||||
ENC004541 | 0.782 | D05VQI | 0.267 | ||||
ENC004468 | 0.766 | D0V3ZA | 0.264 | ||||
ENC005440 | 0.750 | D0TB8C | 0.260 | ||||
ENC005441 | 0.748 | D09NNH | 0.257 | ||||
ENC005439 | 0.732 | D0SP3D | 0.257 | ||||
ENC003331 | 0.729 | D0E9KA | 0.252 | ||||
ENC002762 | 0.728 | D0D7KC | 0.252 | ||||
ENC003653 | 0.722 | D0R1BD | 0.250 |