![]() |
Name |
Emerxanthone B
|
Molecular Formula | C41H46O10 | |
IUPAC Name* |
[1-(1,11-dihydroxy-5-methyl-12-oxo-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-8-yl)-3-hydroxy-3-methylbutan-2-yl]2,4-dihydroxy-6-nona-3,5-dienylbenzoate
|
|
SMILES |
C=C(C)C1COc2c(C)cc3oc4c(CC(OC(=O)c5c(O)cc(O)cc5CCC=CC=CCCC)C(C)(C)O)ccc(O)c4c(=O)c3c2C1O
|
|
InChI |
InChI=1S/C41H46O10/c1-7-8-9-10-11-12-13-14-24-18-26(42)20-29(44)32(24)40(47)51-31(41(5,6)48)19-25-15-16-28(43)33-37(46)34-30(50-39(25)33)17-23(4)38-35(34)36(45)27(21-49-38)22(2)3/h9-12,15-18,20,27,31,36,42-45,48H,2,7-8,13-14,19,21H2,1,3-6H3/b10-9-,12-11-/t27-,31+,36-/m0/s1
|
|
InChIKey |
QQMVTFUVWSNNNG-CHMQUIHBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 698.81 | ALogp: | 7.4 |
HBD: | 5 | HBA: | 10 |
Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 166.9 | Aromatic Rings: | 5 |
Heavy Atoms: | 51 | QED Weighted: | 0.043 |
Caco-2 Permeability: | -5.163 | MDCK Permeability: | 0.00001380 |
Pgp-inhibitor: | 0.933 | Pgp-substrate: | 0.352 |
Human Intestinal Absorption (HIA): | 0.146 | 20% Bioavailability (F20%): | 0.017 |
30% Bioavailability (F30%): | 0.017 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 100.09% |
Volume Distribution (VD): | 0.361 | Fu: | 1.14% |
CYP1A2-inhibitor: | 0.375 | CYP1A2-substrate: | 0.81 |
CYP2C19-inhibitor: | 0.299 | CYP2C19-substrate: | 0.061 |
CYP2C9-inhibitor: | 0.421 | CYP2C9-substrate: | 0.966 |
CYP2D6-inhibitor: | 0.819 | CYP2D6-substrate: | 0.664 |
CYP3A4-inhibitor: | 0.176 | CYP3A4-substrate: | 0.164 |
Clearance (CL): | 2.554 | Half-life (T1/2): | 0.161 |
hERG Blockers: | 0.29 | Human Hepatotoxicity (H-HT): | 0.603 |
Drug-inuced Liver Injury (DILI): | 0.598 | AMES Toxicity: | 0.576 |
Rat Oral Acute Toxicity: | 0.503 | Maximum Recommended Daily Dose: | 0.98 |
Skin Sensitization: | 0.951 | Carcinogencity: | 0.311 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.144 |
Respiratory Toxicity: | 0.118 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004537 | ![]() |
1.000 | D0K8KX | ![]() |
0.266 | ||
ENC002651 | ![]() |
0.555 | D04AIT | ![]() |
0.245 | ||
ENC002697 | ![]() |
0.537 | D0AZ8C | ![]() |
0.240 | ||
ENC002623 | ![]() |
0.503 | D0Q0PR | ![]() |
0.233 | ||
ENC002341 | ![]() |
0.490 | D0O1UZ | ![]() |
0.230 | ||
ENC004314 | ![]() |
0.466 | D07MGA | ![]() |
0.218 | ||
ENC004145 | ![]() |
0.459 | D0FX2Q | ![]() |
0.213 | ||
ENC002544 | ![]() |
0.440 | D07UBG | ![]() |
0.213 | ||
ENC002916 | ![]() |
0.423 | D06GCK | ![]() |
0.208 | ||
ENC006093 | ![]() |
0.423 | D03RTK | ![]() |
0.207 |