![]() |
Name |
ruguloxanthone C
|
Molecular Formula | C25H26O6 | |
IUPAC Name* |
(1R,2S)-1,11-dihydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one
|
|
SMILES |
CC1=CC2=C(C3=C1OC[C@@H]([C@H]3O)C(=C)C)C(=O)C4=C(C=CC(=C4O2)C[C@H](C(=C)C)O)O
|
|
InChI |
InChI=1S/C25H26O6/c1-11(2)15-10-30-24-13(5)8-18-20(21(24)22(15)28)23(29)19-16(26)7-6-14(25(19)31-18)9-17(27)12(3)4/h6-8,15,17,22,26-28H,1,3,9-10H2,2,4-5H3/t15-,17-,22-/m1/s1
|
|
InChIKey |
FWZVIXCVUFFFJG-ZDPZECHZSA-N
|
|
Synonyms |
ruguloxanthone C; CHEMBL1079727
|
|
CAS | NA | |
PubChem CID | 44255066 | |
ChEMBL ID | CHEMBL1079727 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 422.5 | ALogp: | 4.8 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 31 | QED Weighted: | 0.417 |
Caco-2 Permeability: | -5.217 | MDCK Permeability: | 0.00000783 |
Pgp-inhibitor: | 0.494 | Pgp-substrate: | 0.952 |
Human Intestinal Absorption (HIA): | 0.074 | 20% Bioavailability (F20%): | 0.017 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.007 | Plasma Protein Binding (PPB): | 89.96% |
Volume Distribution (VD): | 0.973 | Fu: | 6.44% |
CYP1A2-inhibitor: | 0.624 | CYP1A2-substrate: | 0.885 |
CYP2C19-inhibitor: | 0.151 | CYP2C19-substrate: | 0.162 |
CYP2C9-inhibitor: | 0.605 | CYP2C9-substrate: | 0.836 |
CYP2D6-inhibitor: | 0.409 | CYP2D6-substrate: | 0.307 |
CYP3A4-inhibitor: | 0.164 | CYP3A4-substrate: | 0.171 |
Clearance (CL): | 1.637 | Half-life (T1/2): | 0.083 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.852 |
Drug-inuced Liver Injury (DILI): | 0.908 | AMES Toxicity: | 0.551 |
Rat Oral Acute Toxicity: | 0.779 | Maximum Recommended Daily Dose: | 0.975 |
Skin Sensitization: | 0.481 | Carcinogencity: | 0.893 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.304 |
Respiratory Toxicity: | 0.355 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004145 | ![]() |
0.796 | D0K8KX | ![]() |
0.263 | ||
ENC002651 | ![]() |
0.781 | D0Q0PR | ![]() |
0.253 | ||
ENC002341 | ![]() |
0.766 | D0F7CS | ![]() |
0.248 | ||
ENC002697 | ![]() |
0.765 | D0O1UZ | ![]() |
0.246 | ||
ENC002916 | ![]() |
0.644 | D04AIT | ![]() |
0.246 | ||
ENC006093 | ![]() |
0.644 | D06GCK | ![]() |
0.244 | ||
ENC002544 | ![]() |
0.632 | D0O6KE | ![]() |
0.230 | ||
ENC004314 | ![]() |
0.579 | D0R9WP | ![]() |
0.226 | ||
ENC004537 | ![]() |
0.503 | D03DJL | ![]() |
0.221 | ||
ENC004538 | ![]() |
0.503 | D0G7IY | ![]() |
0.218 |