![]() |
Name |
(2S,5S)-5-[(2R,5S)-5-[(2R,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-(hydroxymethyl)oxane-2,3,4-triol
|
Molecular Formula | C25H43NO18 | |
IUPAC Name* |
(2S,5S)-5-[(2R,5S)-5-[(2R,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-(hydroxymethyl)oxane-2,3,4-triol
|
|
SMILES |
C[C@@H]1[C@H](C(C([C@H](O1)O[C@@H]2C(O[C@@H](C(C2O)O)O[C@@H]3C(O[C@@H](C(C3O)O)O)CO)CO)O)O)N[C@H]4C=C(C(C(C4O)O)O)CO
|
|
InChI |
InChI=1S/C25H43NO18/c1-6-11(26-8-2-7(3-27)12(30)15(33)13(8)31)14(32)19(37)24(40-6)43-22-10(5-29)42-25(20(38)17(22)35)44-21-9(4-28)41-23(39)18(36)16(21)34/h2,6,8-39H,3-5H2,1H3/t6-,8+,9?,10?,11-,12?,13?,14?,15?,16?,17?,18?,19?,20?,21-,22-,23+,24-,25-/m1/s1
|
|
InChIKey |
XUFXOAAUWZOOIT-KBHVOTSXSA-N
|
|
Synonyms |
acarbose; 56180-94-0
|
|
CAS | 56180-94-0 | |
PubChem CID | 163284948 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 645.6 | ALogp: | -8.5 |
HBD: | 14 | HBA: | 19 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 321.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 44 | QED Weighted: | 0.083 |
Caco-2 Permeability: | -6.349 | MDCK Permeability: | 0.00081118 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.941 |
Human Intestinal Absorption (HIA): | 1 | 20% Bioavailability (F20%): | 0.969 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.388 | Plasma Protein Binding (PPB): | 9.67% |
Volume Distribution (VD): | 0.117 | Fu: | 64.46% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.002 |
CYP2C19-inhibitor: | 0.004 | CYP2C19-substrate: | 0.047 |
CYP2C9-inhibitor: | 0 | CYP2C9-substrate: | 0.045 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.054 |
CYP3A4-inhibitor: | 0.002 | CYP3A4-substrate: | 0 |
Clearance (CL): | 0.65 | Half-life (T1/2): | 0.81 |
hERG Blockers: | 0.049 | Human Hepatotoxicity (H-HT): | 0.306 |
Drug-inuced Liver Injury (DILI): | 0.984 | AMES Toxicity: | 0.106 |
Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.006 |
Skin Sensitization: | 0.01 | Carcinogencity: | 0.081 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0.159 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC0049112 | ![]() |
0.593 | D0AD5C | ![]() |
1.000 | ||
ENC002797 | ![]() |
0.378 | D0A8RX | ![]() |
0.562 | ||
ENC002180 | ![]() |
0.370 | D07BSE | ![]() |
0.469 | ||
ENC002950 | ![]() |
0.353 | D04NDM | ![]() |
0.435 | ||
ENC002655 | ![]() |
0.345 | D0YV1Q | ![]() |
0.401 | ||
ENC002245 | ![]() |
0.343 | D05JNI | ![]() |
0.400 | ||
ENC001894 | ![]() |
0.338 | D0P2IT | ![]() |
0.391 | ||
ENC001933 | ![]() |
0.336 | D04MRG | ![]() |
0.390 | ||
ENC001939 | ![]() |
0.317 | D0Y3MO | ![]() |
0.380 | ||
ENC001938 | ![]() |
0.310 | D07XBE | ![]() |
0.354 |