![]() |
Name |
(1S,2R,5R,7R,10S,11S,14S,16S,19S,20R,23R,25R,28S,29S,32S,34S)-5,23-diethyl-2,11,14,20,29,32-hexamethyl-4,13,22,31,37,38,39,40-octaoxapentacyclo[32.2.1.17,10.116,19.125,28]tetracontane-3,12,21,30-tetrone
|
Molecular Formula | C42H68O12 | |
IUPAC Name* |
(1S,2R,5R,7R,10S,11S,14S,16S,19S,20R,23R,25R,28S,29S,32S,34S)-5,23-diethyl-2,11,14,20,29,32-hexamethyl-4,13,22,31,37,38,39,40-octaoxapentacyclo[32.2.1.17,10.116,19.125,28]tetracontane-3,12,21,30-tetrone
|
|
SMILES |
CC[C@@H]1C[C@H]2CC[C@H](O2)[C@@H](C(=O)O[C@H](C[C@@H]3CC[C@H](O3)[C@H](C(=O)O[C@@H](C[C@H]4CC[C@H](O4)[C@@H](C(=O)O[C@H](C[C@@H]5CC[C@H](O5)[C@H](C(=O)O1)C)C)C)CC)C)C)C
|
|
InChI |
InChI=1S/C42H68O12/c1-9-29-21-33-13-17-35(51-33)25(5)39(43)47-24(4)20-32-12-16-38(50-32)28(8)42(46)54-30(10-2)22-34-14-18-36(52-34)26(6)40(44)48-23(3)19-31-11-15-37(49-31)27(7)41(45)53-29/h23-38H,9-22H2,1-8H3/t23-,24-,25-,26-,27+,28+,29+,30+,31-,32-,33+,34+,35-,36-,37-,38-/m0/s1
|
|
InChIKey |
ZBDGIMZKOJALMU-MTEJSUMRSA-N
|
|
Synonyms |
Dinactin; NSC63925; 20261-85-2; HY-121333
|
|
CAS | 20261-85-2 | |
PubChem CID | 156588868 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 765.0 | ALogp: | 7.7 |
HBD: | 0 | HBA: | 12 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 142.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 54 | QED Weighted: | 0.217 |
Caco-2 Permeability: | -4.639 | MDCK Permeability: | 0.00024330 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.023 |
Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.032 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 77.01% |
Volume Distribution (VD): | 1.478 | Fu: | 10.00% |
CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.062 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.809 |
CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.011 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.042 |
CYP3A4-inhibitor: | 0.893 | CYP3A4-substrate: | 0.707 |
Clearance (CL): | 10.126 | Half-life (T1/2): | 0.002 |
hERG Blockers: | 0.473 | Human Hepatotoxicity (H-HT): | 0.967 |
Drug-inuced Liver Injury (DILI): | 0.96 | AMES Toxicity: | 0.968 |
Rat Oral Acute Toxicity: | 0.038 | Maximum Recommended Daily Dose: | 0.997 |
Skin Sensitization: | 0.988 | Carcinogencity: | 0.151 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.856 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005745 | ![]() |
0.740 | D0KK2E | ![]() |
0.289 | ||
ENC002054 | ![]() |
0.353 | D09WCM | ![]() |
0.258 | ||
ENC004418 | ![]() |
0.249 | D0Z4UN | ![]() |
0.248 | ||
ENC001476 | ![]() |
0.222 | D03LJR | ![]() |
0.243 | ||
ENC004935 | ![]() |
0.211 | D0K3QS | ![]() |
0.240 | ||
ENC004466 | ![]() |
0.210 | D08NLN | ![]() |
0.239 | ||
ENC003127 | ![]() |
0.192 | D06OMK | ![]() |
0.235 | ||
ENC003639 | ![]() |
0.192 | D0V7WS | ![]() |
0.232 | ||
ENC003727 | ![]() |
0.191 | D0V3GA | ![]() |
0.231 | ||
ENC004223 | ![]() |
0.191 | D02YIZ | ![]() |
0.230 |