![]() |
Name |
Lobophorin F
|
Molecular Formula | C54H78N2O17 | |
IUPAC Name* |
methyl N-[(2S,3S,4R,6R)-6-[[(3S,6S,13R,16R,17R,18R,20R,21S,22R)-17-[(2S,4R,5S,6S)-4-[(2R,4R,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-hydroxy-6-methyloxan-2-yl]oxy-23-hydroxy-3,4,8,12,18,20,22-heptamethyl-25,27-dioxo-26-oxapentacyclo[22.2.1.01,6.013,22.016,21]heptacosa-4,7,11,14,23-pentaen-9-yl]oxy]-2,4-dimethyl-4-nitrooxan-3-yl]carbamate
|
|
SMILES |
C[C@@H]1C[C@H]([C@H]([C@H]2[C@H]1[C@@]3([C@H](C=C2)C(=CCC(C(=C[C@@H]4C=C([C@H](CC45C(=O)C(=C3O)C(=O)O5)C)C)C)O[C@H]6C[C@@]([C@@H]([C@@H](O6)C)NC(=O)OC)(C)[N+](=O)[O-])C)C)O[C@@H]7C[C@H]([C@H]([C@@H](O7)C)O)O[C@@H]8C[C@H]([C@H]([C@@H](O8)C)O)O)C
|
|
InChI |
InChI=1S/C54H78N2O17/c1-24-13-16-37(70-41-23-52(10,56(64)65)47(32(9)69-41)55-51(63)66-12)26(3)19-33-18-25(2)29(6)22-54(33)49(61)42(50(62)73-54)48(60)53(11)35(24)15-14-34-43(53)27(4)17-28(5)46(34)72-40-21-38(45(59)31(8)68-40)71-39-20-36(57)44(58)30(7)67-39/h13-15,18-19,27-41,43-47,57-60H,16-17,20-23H2,1-12H3,(H,55,63)/t27-,28-,29+,30+,31+,32+,33+,34-,35-,36-,37?,38-,39-,40-,41+,43+,44+,45+,46-,47-,52-,53+,54?/m1/s1
|
|
InChIKey |
MVMHAFZCUXRAAA-TZKIJQPBSA-N
|
|
Synonyms |
Lobophorin F
|
|
CAS | NA | |
PubChem CID | 139584897 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 1027.2 | ALogp: | 5.8 |
HBD: | 5 | HBA: | 17 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 264.0 | Aromatic Rings: | 8 |
Heavy Atoms: | 73 | QED Weighted: | 0.06 |
Caco-2 Permeability: | -5.365 | MDCK Permeability: | 0.00025095 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 1 |
Human Intestinal Absorption (HIA): | 0.142 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.257 |
Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 82.60% |
Volume Distribution (VD): | 1.27 | Fu: | 9.34% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.811 |
CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.631 |
CYP2C9-inhibitor: | 0.069 | CYP2C9-substrate: | 0.002 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.05 |
CYP3A4-inhibitor: | 0.94 | CYP3A4-substrate: | 0.919 |
Clearance (CL): | 10.474 | Half-life (T1/2): | 0.044 |
hERG Blockers: | 0.194 | Human Hepatotoxicity (H-HT): | 0.986 |
Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.896 |
Rat Oral Acute Toxicity: | 0.959 | Maximum Recommended Daily Dose: | 0.961 |
Skin Sensitization: | 0.144 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.977 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003730 | ![]() |
0.843 | D06EPF | ![]() |
0.369 | ||
ENC003621 | ![]() |
0.794 | D03KTD | ![]() |
0.365 | ||
ENC003727 | ![]() |
0.730 | D09YHJ | ![]() |
0.360 | ||
ENC004292 | ![]() |
0.730 | D0L4SD | ![]() |
0.335 | ||
ENC004223 | ![]() |
0.730 | D0V3GA | ![]() |
0.332 | ||
ENC003877 | ![]() |
0.721 | D0F5OR | ![]() |
0.331 | ||
ENC004293 | ![]() |
0.716 | D0Q6OS | ![]() |
0.326 | ||
ENC003236 | ![]() |
0.713 | D01UBX | ![]() |
0.317 | ||
ENC004294 | ![]() |
0.708 | D0TG7I | ![]() |
0.315 | ||
ENC003260 | ![]() |
0.600 | D02OZE | ![]() |
0.315 |