|
Name |
Lobophorin CR3
|
Molecular Formula | C61H90N2O23 | |
IUPAC Name* |
methyl N-[(2R,3R,4S,6R)-6-[[(1S,3R,6S,7E,9S,13S,16S,17S,18S,20S,21R,22S)-11-hydroperoxy-23-hydroxy-17-[(2R,4R,5S,6S)-5-hydroxy-4-[(2S,4R,5S,6R)-6-hydroxy-5-[(2S,4R,5R,6S)-4-hydroxy-5-methoxy-6-methyloxan-2-yl]oxy-4-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-(hydroxymethyl)-3,8,18,20,22-pentamethyl-12-methylidene-25,27-dioxo-26-oxapentacyclo[22.2.1.01,6.013,22.016,21]heptacosa-4,7,14,23-tetraen-9-yl]oxy]-2,4-dimethyl-4-nitrooxan-3-yl]carbamate
|
|
SMILES |
C[C@H]1C[C@@H]([C@@H]([C@@H]2[C@@H]1[C@]3([C@@H](C=C2)C(=C)C(C[C@@H](/C(=C/[C@@H]4C=C([C@@H](C[C@@]45C(=O)C(=C3O)C(=O)O5)C)CO)/C)O[C@H]6C[C@]([C@H]([C@H](O6)C)NC(=O)OC)(C)[N+](=O)[O-])OO)C)O[C@H]7C[C@H]([C@H]([C@@H](O7)C)O)O[C@@H]8C[C@H]([C@@H]([C@@H](O8)O)O[C@H]9C[C@H]([C@H]([C@@H](O9)C)OC)O)C)C
|
|
InChI |
InChI=1S/C61H90N2O23/c1-26-17-36-19-35(25-64)30(5)23-61(36)55(68)47(56(69)85-61)54(67)60(11)38(31(6)41(86-74)21-40(26)80-46-24-59(10,63(72)73)53(34(9)79-46)62-58(71)76-13)15-14-37-48(60)27(2)16-28(3)50(37)82-45-22-42(49(66)32(7)77-45)81-43-18-29(4)51(57(70)84-43)83-44-20-39(65)52(75-12)33(8)78-44/h14-15,17,19,27-30,32-34,36-46,48-53,57,64-67,70,74H,6,16,18,20-25H2,1-5,7-13H3,(H,62,71)/b26-17+,54-47?/t27-,28-,29+,30+,32-,33-,34+,36+,37-,38-,39+,40-,41?,42+,43-,44-,45-,46-,48+,49-,50-,51-,52-,53-,57+,59-,60+,61-/m0/s1
|
|
InChIKey |
QYPVKZPVQCWZQL-ONZQNPCKSA-N
|
|
Synonyms |
Lobophorin CR3
|
|
CAS | NA | |
PubChem CID | 156581183 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 1219.4 | ALogp: | 4.4 |
HBD: | 7 | HBA: | 23 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 341.0 | Aromatic Rings: | 9 |
Heavy Atoms: | 86 | QED Weighted: | 0.03 |
Caco-2 Permeability: | -5.884 | MDCK Permeability: | 0.00076732 |
Pgp-inhibitor: | 0.126 | Pgp-substrate: | 1 |
Human Intestinal Absorption (HIA): | 0.865 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.782 |
Blood-Brain-Barrier Penetration (BBB): | 0.03 | Plasma Protein Binding (PPB): | 79.23% |
Volume Distribution (VD): | 0.69 | Fu: | 10.42% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.909 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.506 |
CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.033 |
CYP3A4-inhibitor: | 0.862 | CYP3A4-substrate: | 0.913 |
Clearance (CL): | 4.789 | Half-life (T1/2): | 0.021 |
hERG Blockers: | 0.245 | Human Hepatotoxicity (H-HT): | 0.936 |
Drug-inuced Liver Injury (DILI): | 0.99 | AMES Toxicity: | 0.971 |
Rat Oral Acute Toxicity: | 0.988 | Maximum Recommended Daily Dose: | 0.998 |
Skin Sensitization: | 0.235 | Carcinogencity: | 0.13 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0.992 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004293 | 0.946 | D03KTD | 0.395 | ||||
ENC004292 | 0.832 | D06EPF | 0.358 | ||||
ENC003730 | 0.783 | D0P6IK | 0.349 | ||||
ENC003727 | 0.775 | D0SL2V | 0.349 | ||||
ENC004223 | 0.775 | D09HTS | 0.343 | ||||
ENC003621 | 0.774 | D0L4SD | 0.334 | ||||
ENC003877 | 0.773 | D07TGN | 0.328 | ||||
ENC003236 | 0.732 | D0V3GA | 0.323 | ||||
ENC003639 | 0.708 | D0Q6OS | 0.322 | ||||
ENC003260 | 0.502 | D09YHJ | 0.318 |