![]() |
Name |
Lobophorin CR2
|
Molecular Formula | C61H90N2O22 | |
IUPAC Name* |
methyl N-[(2R,3R,4S,6R)-6-[[(1S,3R,6S,7E,9S,13S,16S,17S,18S,20S,21R,22S)-11,23-dihydroxy-17-[(2R,4R,5S,6S)-5-hydroxy-4-[(2S,4R,5S,6R)-6-hydroxy-5-[(2S,4R,5R,6S)-4-hydroxy-5-methoxy-6-methyloxan-2-yl]oxy-4-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-(hydroxymethyl)-3,8,18,20,22-pentamethyl-12-methylidene-25,27-dioxo-26-oxapentacyclo[22.2.1.01,6.013,22.016,21]heptacosa-4,7,14,23-tetraen-9-yl]oxy]-2,4-dimethyl-4-nitrooxan-3-yl]carbamate
|
|
SMILES |
C[C@H]1C[C@@H]([C@@H]([C@@H]2[C@@H]1[C@]3([C@@H](C=C2)C(=C)C(C[C@@H](/C(=C/[C@@H]4C=C([C@@H](C[C@@]45C(=O)C(=C3O)C(=O)O5)C)CO)/C)O[C@H]6C[C@]([C@H]([C@H](O6)C)NC(=O)OC)(C)[N+](=O)[O-])O)C)O[C@H]7C[C@H]([C@H]([C@@H](O7)C)O)O[C@@H]8C[C@H]([C@@H]([C@@H](O8)O)O[C@H]9C[C@H]([C@H]([C@@H](O9)C)OC)O)C)C
|
|
InChI |
InChI=1S/C61H90N2O22/c1-26-17-36-19-35(25-64)30(5)23-61(36)55(69)47(56(70)85-61)54(68)60(11)38(31(6)39(65)20-41(26)80-46-24-59(10,63(73)74)53(34(9)79-46)62-58(72)76-13)15-14-37-48(60)27(2)16-28(3)50(37)82-45-22-42(49(67)32(7)77-45)81-43-18-29(4)51(57(71)84-43)83-44-21-40(66)52(75-12)33(8)78-44/h14-15,17,19,27-30,32-34,36-46,48-53,57,64-68,71H,6,16,18,20-25H2,1-5,7-13H3,(H,62,72)/b26-17+,54-47?/t27-,28-,29+,30+,32-,33-,34+,36+,37-,38-,39?,40+,41-,42+,43-,44-,45-,46-,48+,49-,50-,51-,52-,53-,57+,59-,60+,61-/m0/s1
|
|
InChIKey |
HHGVCWNZIMOCIY-UXWRROBPSA-N
|
|
Synonyms |
Lobophorin CR2
|
|
CAS | NA | |
PubChem CID | 156581182 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 1203.4 | ALogp: | 4.4 |
HBD: | 7 | HBA: | 22 |
Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 332.0 | Aromatic Rings: | 9 |
Heavy Atoms: | 85 | QED Weighted: | 0.044 |
Caco-2 Permeability: | -5.904 | MDCK Permeability: | 0.00069722 |
Pgp-inhibitor: | 0.158 | Pgp-substrate: | 1 |
Human Intestinal Absorption (HIA): | 0.853 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.881 |
Blood-Brain-Barrier Penetration (BBB): | 0.035 | Plasma Protein Binding (PPB): | 76.63% |
Volume Distribution (VD): | 0.657 | Fu: | 9.16% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.873 |
CYP2C19-inhibitor: | 0.011 | CYP2C19-substrate: | 0.518 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.026 |
CYP3A4-inhibitor: | 0.854 | CYP3A4-substrate: | 0.917 |
Clearance (CL): | 4.633 | Half-life (T1/2): | 0.024 |
hERG Blockers: | 0.316 | Human Hepatotoxicity (H-HT): | 0.934 |
Drug-inuced Liver Injury (DILI): | 0.991 | AMES Toxicity: | 0.939 |
Rat Oral Acute Toxicity: | 0.992 | Maximum Recommended Daily Dose: | 0.999 |
Skin Sensitization: | 0.169 | Carcinogencity: | 0.123 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0.992 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004294 | ![]() |
0.946 | D03KTD | ![]() |
0.394 | ||
ENC004292 | ![]() |
0.842 | D06EPF | ![]() |
0.366 | ||
ENC003730 | ![]() |
0.792 | D0P6IK | ![]() |
0.357 | ||
ENC004223 | ![]() |
0.784 | D0SL2V | ![]() |
0.357 | ||
ENC003727 | ![]() |
0.784 | D09HTS | ![]() |
0.350 | ||
ENC003621 | ![]() |
0.783 | D0L4SD | ![]() |
0.342 | ||
ENC003877 | ![]() |
0.782 | D07TGN | ![]() |
0.335 | ||
ENC003236 | ![]() |
0.734 | D0Q6OS | ![]() |
0.330 | ||
ENC003639 | ![]() |
0.716 | D0V3GA | ![]() |
0.327 | ||
ENC003260 | ![]() |
0.508 | D0M9QK | ![]() |
0.324 |