|
Name |
Incarxanthone F
|
Molecular Formula | C30H23NO12 | |
IUPAC Name* |
methyl 8-hydroxy-9-oxo-2-[[(1R,2R,3R)-1,2,8-trihydroxy-1-methoxycarbonyl-9-oxo-3,4-dihydro-2H-xanthen-3-yl]amino]xanthene-1-carboxylate
|
|
SMILES |
COC(=O)C1=C(C=CC2=C1C(=O)C3=C(C=CC=C3O2)O)N[C@@H]4CC5=C(C(=O)C6=C(C=CC=C6O5)O)[C@@]([C@@H]4O)(C(=O)OC)O
|
|
InChI |
InChI=1S/C30H23NO12/c1-40-28(37)20-12(9-10-18-23(20)25(34)21-14(32)5-3-7-16(21)42-18)31-13-11-19-24(30(39,27(13)36)29(38)41-2)26(35)22-15(33)6-4-8-17(22)43-19/h3-10,13,27,31-33,36,39H,11H2,1-2H3/t13-,27-,30-/m1/s1
|
|
InChIKey |
SETPGQKQIHMBAF-ZHEHGQCCSA-N
|
|
Synonyms |
Incarxanthone F; CHEMBL4741126
|
|
CAS | NA | |
PubChem CID | 156580929 | |
ChEMBL ID | CHEMBL4741126 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 589.5 | ALogp: | 4.2 |
HBD: | 5 | HBA: | 13 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 198.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 43 | QED Weighted: | 0.151 |
Caco-2 Permeability: | -5.755 | MDCK Permeability: | 0.00000529 |
Pgp-inhibitor: | 0.118 | Pgp-substrate: | 0.995 |
Human Intestinal Absorption (HIA): | 0.87 | 20% Bioavailability (F20%): | 0.052 |
30% Bioavailability (F30%): | 0.994 |
Blood-Brain-Barrier Penetration (BBB): | 0.024 | Plasma Protein Binding (PPB): | 91.37% |
Volume Distribution (VD): | 0.625 | Fu: | 12.55% |
CYP1A2-inhibitor: | 0.169 | CYP1A2-substrate: | 0.958 |
CYP2C19-inhibitor: | 0.152 | CYP2C19-substrate: | 0.097 |
CYP2C9-inhibitor: | 0.844 | CYP2C9-substrate: | 0.595 |
CYP2D6-inhibitor: | 0.103 | CYP2D6-substrate: | 0.216 |
CYP3A4-inhibitor: | 0.463 | CYP3A4-substrate: | 0.749 |
Clearance (CL): | 0.916 | Half-life (T1/2): | 0.371 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.923 |
Drug-inuced Liver Injury (DILI): | 0.986 | AMES Toxicity: | 0.64 |
Rat Oral Acute Toxicity: | 0.674 | Maximum Recommended Daily Dose: | 0.713 |
Skin Sensitization: | 0.415 | Carcinogencity: | 0.127 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.018 |
Respiratory Toxicity: | 0.047 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002954 | 0.472 | D0G7IY | 0.329 | ||||
ENC004284 | 0.472 | D06NSS | 0.297 | ||||
ENC002284 | 0.451 | D02TJS | 0.267 | ||||
ENC004886 | 0.451 | D0T5XN | 0.242 | ||||
ENC004285 | 0.448 | D01XWG | 0.240 | ||||
ENC004885 | 0.411 | D0Q0PR | 0.240 | ||||
ENC002283 | 0.411 | D0H1AR | 0.238 | ||||
ENC003641 | 0.401 | D07VLY | 0.236 | ||||
ENC004244 | 0.401 | D0C9XJ | 0.236 | ||||
ENC004286 | 0.382 | D0Q2HO | 0.236 |