![]() |
Name |
Incarxanthone B
|
Molecular Formula | C15H14O7S | |
IUPAC Name* |
methyl (1R,2R,3R)-1,2,8-trihydroxy-9-oxo-3-sulfanyl-3,4-dihydro-2H-xanthene-1-carboxylate
|
|
SMILES |
COC(=O)[C@@]1([C@H]([C@@H](CC2=C1C(=O)C3=C(C=CC=C3O2)O)S)O)O
|
|
InChI |
InChI=1S/C15H14O7S/c1-21-14(19)15(20)11-8(5-9(23)13(15)18)22-7-4-2-3-6(16)10(7)12(11)17/h2-4,9,13,16,18,20,23H,5H2,1H3/t9-,13+,15-/m1/s1
|
|
InChIKey |
MEJFVCYHOZYGOX-ZDBHGNHJSA-N
|
|
Synonyms |
Incarxanthone B; CHEMBL4781464
|
|
CAS | NA | |
PubChem CID | 156580924 | |
ChEMBL ID | CHEMBL4781464 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.3 | ALogp: | 1.1 |
HBD: | 4 | HBA: | 8 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 114.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.441 |
Caco-2 Permeability: | -5.436 | MDCK Permeability: | 0.00000408 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.565 |
Human Intestinal Absorption (HIA): | 0.086 | 20% Bioavailability (F20%): | 0.019 |
30% Bioavailability (F30%): | 0.642 |
Blood-Brain-Barrier Penetration (BBB): | 0.209 | Plasma Protein Binding (PPB): | 96.91% |
Volume Distribution (VD): | 1 | Fu: | 5.16% |
CYP1A2-inhibitor: | 0.182 | CYP1A2-substrate: | 0.913 |
CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.24 |
CYP2C9-inhibitor: | 0.053 | CYP2C9-substrate: | 0.394 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.188 |
CYP3A4-inhibitor: | 0.09 | CYP3A4-substrate: | 0.254 |
Clearance (CL): | 3.241 | Half-life (T1/2): | 0.812 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.889 |
Drug-inuced Liver Injury (DILI): | 0.978 | AMES Toxicity: | 0.827 |
Rat Oral Acute Toxicity: | 0.26 | Maximum Recommended Daily Dose: | 0.143 |
Skin Sensitization: | 0.264 | Carcinogencity: | 0.055 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.042 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002954 | ![]() |
0.789 | D0S0LZ | ![]() |
0.259 | ||
ENC004284 | ![]() |
0.789 | D0H1AR | ![]() |
0.259 | ||
ENC004286 | ![]() |
0.653 | D08NQZ | ![]() |
0.259 | ||
ENC002349 | ![]() |
0.627 | D07MGA | ![]() |
0.255 | ||
ENC004884 | ![]() |
0.627 | D0J2NK | ![]() |
0.254 | ||
ENC004138 | ![]() |
0.610 | D0K8KX | ![]() |
0.245 | ||
ENC004287 | ![]() |
0.579 | D01XWG | ![]() |
0.241 | ||
ENC002671 | ![]() |
0.466 | D02NSF | ![]() |
0.240 | ||
ENC004290 | ![]() |
0.448 | D08QJS | ![]() |
0.236 | ||
ENC004886 | ![]() |
0.429 | D07VLY | ![]() |
0.235 |