![]() |
Name |
Vertixanthone
|
Molecular Formula | C15H10O5 | |
IUPAC Name* |
methyl 8-hydroxy-9-oxoxanthene-1-carboxylate
|
|
SMILES |
COC(=O)C1=C2C(=CC=C1)OC3=CC=CC(=C3C2=O)O
|
|
InChI |
InChI=1S/C15H10O5/c1-19-15(18)8-4-2-6-10-12(8)14(17)13-9(16)5-3-7-11(13)20-10/h2-7,16H,1H3
|
|
InChIKey |
HXAFEJLAMMEJCI-UHFFFAOYSA-N
|
|
Synonyms |
Vertixanthone; 120461-93-0
|
|
CAS | NA | |
PubChem CID | 14309393 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 270.24 | ALogp: | 3.0 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 20 | QED Weighted: | 0.542 |
Caco-2 Permeability: | -4.835 | MDCK Permeability: | 0.00002660 |
Pgp-inhibitor: | 0.031 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.915 |
Blood-Brain-Barrier Penetration (BBB): | 0.12 | Plasma Protein Binding (PPB): | 90.32% |
Volume Distribution (VD): | 0.741 | Fu: | 9.43% |
CYP1A2-inhibitor: | 0.98 | CYP1A2-substrate: | 0.882 |
CYP2C19-inhibitor: | 0.855 | CYP2C19-substrate: | 0.076 |
CYP2C9-inhibitor: | 0.815 | CYP2C9-substrate: | 0.94 |
CYP2D6-inhibitor: | 0.712 | CYP2D6-substrate: | 0.636 |
CYP3A4-inhibitor: | 0.497 | CYP3A4-substrate: | 0.139 |
Clearance (CL): | 1.852 | Half-life (T1/2): | 0.608 |
hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.077 |
Drug-inuced Liver Injury (DILI): | 0.936 | AMES Toxicity: | 0.443 |
Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.035 |
Skin Sensitization: | 0.907 | Carcinogencity: | 0.367 |
Eye Corrosion: | 0.078 | Eye Irritation: | 0.98 |
Respiratory Toxicity: | 0.139 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004885 | ![]() |
1.000 | D0Y0JH | ![]() |
0.346 | ||
ENC004886 | ![]() |
0.701 | D0G7IY | ![]() |
0.336 | ||
ENC002284 | ![]() |
0.701 | D0E3OF | ![]() |
0.330 | ||
ENC002106 | ![]() |
0.701 | D05HFY | ![]() |
0.320 | ||
ENC002469 | ![]() |
0.671 | D0L5PO | ![]() |
0.316 | ||
ENC005347 | ![]() |
0.563 | D02TJS | ![]() |
0.309 | ||
ENC004887 | ![]() |
0.514 | D05FTJ | ![]() |
0.309 | ||
ENC004883 | ![]() |
0.514 | D0ND2J | ![]() |
0.308 | ||
ENC002462 | ![]() |
0.487 | D0QV5T | ![]() |
0.303 | ||
ENC004289 | ![]() |
0.487 | D08IFL | ![]() |
0.301 |