![]() |
Name |
Penispirozine G
|
Molecular Formula | C21H24N2O9 | |
IUPAC Name* |
(2R,3aR,4S,5R,7aS)-3a,4,5-trihydroxy-6'-[(2-hydroxy-3,4-dimethoxyphenyl)methylidene]-1'-methylspiro[3,4,5,7a-tetrahydro-1-benzofuran-2,3'-piperazine]-2',5'-dione
|
|
SMILES |
CN1C(=CC2=C(C(=C(C=C2)OC)OC)O)C(=O)N[C@]3(C1=O)C[C@@]4([C@@H](O3)C=C[C@H]([C@@H]4O)O)O
|
|
InChI |
InChI=1S/C21H24N2O9/c1-23-11(8-10-4-6-13(30-2)16(31-3)15(10)25)18(27)22-21(19(23)28)9-20(29)14(32-21)7-5-12(24)17(20)26/h4-8,12,14,17,24-26,29H,9H2,1-3H3,(H,22,27)/t12-,14+,17+,20+,21-/m1/s1
|
|
InChIKey |
HCKQCACCKTUAQG-NSBANYLGSA-N
|
|
Synonyms |
Penispirozine G
|
|
CAS | NA | |
PubChem CID | 156580836 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 448.4 | ALogp: | -1.3 |
HBD: | 5 | HBA: | 9 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 158.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 32 | QED Weighted: | 0.299 |
Caco-2 Permeability: | -5.684 | MDCK Permeability: | 0.00000553 |
Pgp-inhibitor: | 0.245 | Pgp-substrate: | 0.574 |
Human Intestinal Absorption (HIA): | 0.87 | 20% Bioavailability (F20%): | 0.987 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.654 | Plasma Protein Binding (PPB): | 71.36% |
Volume Distribution (VD): | 0.938 | Fu: | 28.90% |
CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.962 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.275 |
CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.609 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.166 |
CYP3A4-inhibitor: | 0.027 | CYP3A4-substrate: | 0.366 |
Clearance (CL): | 3.952 | Half-life (T1/2): | 0.849 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.286 |
Drug-inuced Liver Injury (DILI): | 0.96 | AMES Toxicity: | 0.265 |
Rat Oral Acute Toxicity: | 0.177 | Maximum Recommended Daily Dose: | 0.024 |
Skin Sensitization: | 0.39 | Carcinogencity: | 0.208 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.051 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004281 | ![]() |
1.000 | D06GCK | ![]() |
0.279 | ||
ENC004278 | ![]() |
0.753 | D0L1JW | ![]() |
0.275 | ||
ENC004279 | ![]() |
0.753 | D03DIG | ![]() |
0.271 | ||
ENC004276 | ![]() |
0.598 | D01XWG | ![]() |
0.258 | ||
ENC003738 | ![]() |
0.513 | D04TDQ | ![]() |
0.255 | ||
ENC003659 | ![]() |
0.455 | D0C9XJ | ![]() |
0.245 | ||
ENC004277 | ![]() |
0.447 | D07VLY | ![]() |
0.245 | ||
ENC006030 | ![]() |
0.419 | D07MGA | ![]() |
0.244 | ||
ENC002091 | ![]() |
0.379 | D01FFA | ![]() |
0.238 | ||
ENC003545 | ![]() |
0.377 | D0D4HN | ![]() |
0.237 |