![]() |
Name |
Penispirozine F
|
Molecular Formula | C20H22N2O9 | |
IUPAC Name* |
(2S,3aR,4S,5R,7aR)-3a,4,5-trihydroxy-6'-[(2-hydroxy-3,4-dimethoxyphenyl)methylidene]spiro[3,4,5,7a-tetrahydro-1-benzofuran-2,3'-piperazine]-2',5'-dione
|
|
SMILES |
COC1=C(C(=C(C=C1)C=C2C(=O)N[C@]3(C[C@@]4([C@H](O3)C=C[C@H]([C@@H]4O)O)O)C(=O)N2)O)OC
|
|
InChI |
InChI=1S/C20H22N2O9/c1-29-12-5-3-9(14(24)15(12)30-2)7-10-17(26)22-20(18(27)21-10)8-19(28)13(31-20)6-4-11(23)16(19)25/h3-7,11,13,16,23-25,28H,8H2,1-2H3,(H,21,27)(H,22,26)/t11-,13-,16+,19+,20+/m1/s1
|
|
InChIKey |
SVZSHNMALOJOKU-JKRAONCPSA-N
|
|
Synonyms |
Penispirozine F
|
|
CAS | NA | |
PubChem CID | 156580835 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 434.4 | ALogp: | -1.5 |
HBD: | 6 | HBA: | 9 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 167.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 31 | QED Weighted: | 0.26 |
Caco-2 Permeability: | -6.05 | MDCK Permeability: | 0.00000511 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.645 |
Human Intestinal Absorption (HIA): | 0.442 | 20% Bioavailability (F20%): | 0.98 |
30% Bioavailability (F30%): | 0.972 |
Blood-Brain-Barrier Penetration (BBB): | 0.753 | Plasma Protein Binding (PPB): | 47.39% |
Volume Distribution (VD): | 0.694 | Fu: | 31.74% |
CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.968 |
CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.091 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.506 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.187 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.167 |
Clearance (CL): | 2.765 | Half-life (T1/2): | 0.875 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.379 |
Drug-inuced Liver Injury (DILI): | 0.97 | AMES Toxicity: | 0.479 |
Rat Oral Acute Toxicity: | 0.128 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.261 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.041 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D06GCK | ![]() |
0.273 | ||||
![]() |
D03DIG | ![]() |
0.254 | ||||
![]() |
D01XWG | ![]() |
0.253 | ||||
![]() |
D0L1JW | ![]() |
0.250 | ||||
![]() |
D0C9XJ | ![]() |
0.248 | ||||
![]() |
D07VLY | ![]() |
0.248 | ||||
![]() |
D07MGA | ![]() |
0.248 | ||||
![]() |
D04TDQ | ![]() |
0.232 | ||||
![]() |
D0D4HN | ![]() |
0.232 | ||||
![]() |
D09DHY | ![]() |
0.231 |