![]() |
Name |
Phomopoxide B
|
Molecular Formula | C18H32O6 | |
IUPAC Name* |
(1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(Z,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol
|
|
SMILES |
CCCCCCCC[C@@H](/C=C\C1=C([C@H]([C@@H]([C@H]([C@@H]1O)O)O)O)CO)O
|
|
InChI |
InChI=1S/C18H32O6/c1-2-3-4-5-6-7-8-12(20)9-10-13-14(11-19)16(22)18(24)17(23)15(13)21/h9-10,12,15-24H,2-8,11H2,1H3/b10-9-/t12-,15+,16+,17-,18-/m0/s1
|
|
InChIKey |
DAABLEBQAMFRQW-QSBUVSRSSA-N
|
|
Synonyms |
Phomopoxide B
|
|
CAS | NA | |
PubChem CID | 146684222 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 344.4 | ALogp: | 0.4 |
HBD: | 6 | HBA: | 6 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 121.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 24 | QED Weighted: | 0.326 |
Caco-2 Permeability: | -5.102 | MDCK Permeability: | 0.00003400 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.902 |
Human Intestinal Absorption (HIA): | 0.929 | 20% Bioavailability (F20%): | 0.971 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.226 | Plasma Protein Binding (PPB): | 74.97% |
Volume Distribution (VD): | 0.834 | Fu: | 19.63% |
CYP1A2-inhibitor: | 0.112 | CYP1A2-substrate: | 0.048 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.25 |
CYP2C9-inhibitor: | 0.007 | CYP2C9-substrate: | 0.037 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.033 |
CYP3A4-inhibitor: | 0.01 | CYP3A4-substrate: | 0.053 |
Clearance (CL): | 3.192 | Half-life (T1/2): | 0.867 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.152 |
Drug-inuced Liver Injury (DILI): | 0.55 | AMES Toxicity: | 0.084 |
Rat Oral Acute Toxicity: | 0.035 | Maximum Recommended Daily Dose: | 0.866 |
Skin Sensitization: | 0.826 | Carcinogencity: | 0.11 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.728 |
Respiratory Toxicity: | 0.42 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004171 | ![]() |
1.000 | D0I4DQ | ![]() |
0.396 | ||
ENC004175 | ![]() |
0.743 | D06FEA | ![]() |
0.340 | ||
ENC004174 | ![]() |
0.743 | D04RGA | ![]() |
0.339 | ||
ENC004769 | ![]() |
0.549 | D0V0IX | ![]() |
0.337 | ||
ENC004772 | ![]() |
0.528 | D09SRR | ![]() |
0.284 | ||
ENC004173 | ![]() |
0.483 | D0HR8Z | ![]() |
0.280 | ||
ENC004770 | ![]() |
0.405 | D0XN8C | ![]() |
0.278 | ||
ENC004325 | ![]() |
0.375 | D0N3NO | ![]() |
0.275 | ||
ENC004449 | ![]() |
0.372 | D0H2YX | ![]() |
0.265 | ||
ENC004771 | ![]() |
0.367 | D07UHS | ![]() |
0.257 |