![]() |
Name |
Phomopoxide E
|
Molecular Formula | C18H30O5 | |
IUPAC Name* |
(1S,2R,5R,6R)-3-(hydroxymethyl)-4-[(Z,3S)-3-hydroxyundec-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol
|
|
SMILES |
CCCCCCCC[C@@H](/C=C\C1=C([C@H]([C@H]2[C@@H]([C@@H]1O)O2)O)CO)O
|
|
InChI |
InChI=1S/C18H30O5/c1-2-3-4-5-6-7-8-12(20)9-10-13-14(11-19)16(22)18-17(23-18)15(13)21/h9-10,12,15-22H,2-8,11H2,1H3/b10-9-/t12-,15+,16+,17+,18-/m0/s1
|
|
InChIKey |
ZVSANRKMQKUFGR-YAHKWNNFSA-N
|
|
Synonyms |
Phomopoxide E
|
|
CAS | NA | |
PubChem CID | 146684225 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 326.4 | ALogp: | 1.4 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 23 | QED Weighted: | 0.364 |
Caco-2 Permeability: | -5.143 | MDCK Permeability: | 0.00003550 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.964 |
Human Intestinal Absorption (HIA): | 0.602 | 20% Bioavailability (F20%): | 0.991 |
30% Bioavailability (F30%): | 0.994 |
Blood-Brain-Barrier Penetration (BBB): | 0.149 | Plasma Protein Binding (PPB): | 77.09% |
Volume Distribution (VD): | 1.352 | Fu: | 17.60% |
CYP1A2-inhibitor: | 0.066 | CYP1A2-substrate: | 0.083 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.353 |
CYP2C9-inhibitor: | 0.035 | CYP2C9-substrate: | 0.021 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.038 |
CYP3A4-inhibitor: | 0.041 | CYP3A4-substrate: | 0.124 |
Clearance (CL): | 5.199 | Half-life (T1/2): | 0.783 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.866 |
Drug-inuced Liver Injury (DILI): | 0.803 | AMES Toxicity: | 0.103 |
Rat Oral Acute Toxicity: | 0.201 | Maximum Recommended Daily Dose: | 0.965 |
Skin Sensitization: | 0.885 | Carcinogencity: | 0.15 |
Eye Corrosion: | 0.02 | Eye Irritation: | 0.879 |
Respiratory Toxicity: | 0.937 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0I4DQ | ![]() |
0.400 | ||||
![]() |
D0V0IX | ![]() |
0.354 | ||||
![]() |
D06FEA | ![]() |
0.343 | ||||
![]() |
D04RGA | ![]() |
0.319 | ||||
![]() |
D09SRR | ![]() |
0.287 | ||||
![]() |
D0XN8C | ![]() |
0.281 | ||||
![]() |
D0N3NO | ![]() |
0.278 | ||||
![]() |
D0H2YX | ![]() |
0.267 | ||||
![]() |
D07UHS | ![]() |
0.260 | ||||
![]() |
D09ANG | ![]() |
0.255 |