![]() |
Name |
(10S)-12,16-epoxy-17(15-->16)-abeo-3,5,8,12,15-abietapentaen-2,7,11,14-tetraone
|
Molecular Formula | C20H16O5 | |
IUPAC Name* |
(11bS)-3,4,9,11b-tetramethyl-1H-naphtho[2,1-f][1]benzofuran-2,6,7,11-tetrone
|
|
SMILES |
CC1=CC2=C(O1)C(=O)C3=C(C2=O)C(=O)C=C4[C@@]3(CC(=O)C(=C4C)C)C
|
|
InChI |
InChI=1S/C20H16O5/c1-8-5-11-17(23)15-13(21)6-12-9(2)10(3)14(22)7-20(12,4)16(15)18(24)19(11)25-8/h5-6H,7H2,1-4H3/t20-/m0/s1
|
|
InChIKey |
BCQASUIJKLATHD-FQEVSTJZSA-N
|
|
Synonyms |
CHEMBL4448006; (10S)-12,16-epoxy-17(15-->16)-abeo-3,5,8,12,15-abietapentaen-2,7,11,14-tetraone
|
|
CAS | NA | |
PubChem CID | 139591584 | |
ChEMBL ID | CHEMBL4448006 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 336.3 | ALogp: | 1.9 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 81.4 | Aromatic Rings: | 4 |
Heavy Atoms: | 25 | QED Weighted: | 0.672 |
Caco-2 Permeability: | -4.701 | MDCK Permeability: | 0.00001970 |
Pgp-inhibitor: | 0.708 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.616 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 86.64% |
Volume Distribution (VD): | 1.257 | Fu: | 7.22% |
CYP1A2-inhibitor: | 0.966 | CYP1A2-substrate: | 0.898 |
CYP2C19-inhibitor: | 0.886 | CYP2C19-substrate: | 0.442 |
CYP2C9-inhibitor: | 0.863 | CYP2C9-substrate: | 0.086 |
CYP2D6-inhibitor: | 0.924 | CYP2D6-substrate: | 0.025 |
CYP3A4-inhibitor: | 0.729 | CYP3A4-substrate: | 0.172 |
Clearance (CL): | 3.009 | Half-life (T1/2): | 0.048 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.799 |
Drug-inuced Liver Injury (DILI): | 0.742 | AMES Toxicity: | 0.828 |
Rat Oral Acute Toxicity: | 0.179 | Maximum Recommended Daily Dose: | 0.809 |
Skin Sensitization: | 0.494 | Carcinogencity: | 0.922 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.035 |
Respiratory Toxicity: | 0.641 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005237 | ![]() |
0.540 | D0FA2O | ![]() |
0.253 | ||
ENC003030 | ![]() |
0.315 | D0O6KE | ![]() |
0.221 | ||
ENC003505 | ![]() |
0.309 | D06XZW | ![]() |
0.214 | ||
ENC002455 | ![]() |
0.301 | D0G4KG | ![]() |
0.212 | ||
ENC001084 | ![]() |
0.294 | D0C1SF | ![]() |
0.211 | ||
ENC000919 | ![]() |
0.288 | D0K7LU | ![]() |
0.208 | ||
ENC005958 | ![]() |
0.274 | D03GET | ![]() |
0.198 | ||
ENC002620 | ![]() |
0.272 | D01XWG | ![]() |
0.197 | ||
ENC002621 | ![]() |
0.272 | D0N1FS | ![]() |
0.197 | ||
ENC003923 | ![]() |
0.270 | D04XVN | ![]() |
0.191 |