![]() |
Name |
teuvincenone F
|
Molecular Formula | C20H18O5 | |
IUPAC Name* |
7,11-dihydroxy-3,4,9,11b-tetramethyl-1H-naphtho[2,1-f][1]benzofuran-2,6-dione
|
|
SMILES |
CC1=C(C)C2=CC(=O)c3c(c(O)c4oc(C)cc4c3O)C2(C)CC1=O
|
|
InChI |
InChI=1S/C20H18O5/c1-8-5-11-17(23)15-13(21)6-12-9(2)10(3)14(22)7-20(12,4)16(15)18(24)19(11)25-8/h5-6,23-24H,7H2,1-4H3/t20-/m0/s1
|
|
InChIKey |
OAUHNCIOZPVXOD-FQEVSTJZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.36 | ALogp: | 3.8 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.7 | Aromatic Rings: | 4 |
Heavy Atoms: | 25 | QED Weighted: | 0.69 |
Caco-2 Permeability: | -4.888 | MDCK Permeability: | 0.00001680 |
Pgp-inhibitor: | 0.149 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.041 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 91.92% |
Volume Distribution (VD): | 0.831 | Fu: | 9.17% |
CYP1A2-inhibitor: | 0.924 | CYP1A2-substrate: | 0.94 |
CYP2C19-inhibitor: | 0.674 | CYP2C19-substrate: | 0.806 |
CYP2C9-inhibitor: | 0.833 | CYP2C9-substrate: | 0.817 |
CYP2D6-inhibitor: | 0.777 | CYP2D6-substrate: | 0.164 |
CYP3A4-inhibitor: | 0.616 | CYP3A4-substrate: | 0.574 |
Clearance (CL): | 5.546 | Half-life (T1/2): | 0.443 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.269 |
Drug-inuced Liver Injury (DILI): | 0.423 | AMES Toxicity: | 0.331 |
Rat Oral Acute Toxicity: | 0.622 | Maximum Recommended Daily Dose: | 0.433 |
Skin Sensitization: | 0.479 | Carcinogencity: | 0.848 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.191 |
Respiratory Toxicity: | 0.731 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003970 | ![]() |
0.540 | D0FA2O | ![]() |
0.295 | ||
ENC001084 | ![]() |
0.451 | D0G4KG | ![]() |
0.250 | ||
ENC003030 | ![]() |
0.440 | D06XZW | ![]() |
0.244 | ||
ENC004786 | ![]() |
0.380 | D0O6KE | ![]() |
0.232 | ||
ENC002455 | ![]() |
0.375 | D0WY9N | ![]() |
0.230 | ||
ENC005327 | ![]() |
0.365 | D06GCK | ![]() |
0.225 | ||
ENC002706 | ![]() |
0.360 | D0R6RC | ![]() |
0.224 | ||
ENC004989 | ![]() |
0.346 | D02PMO | ![]() |
0.224 | ||
ENC000925 | ![]() |
0.333 | D01XWG | ![]() |
0.223 | ||
ENC002620 | ![]() |
0.330 | D0C1SF | ![]() |
0.222 |