![]() |
Name |
Oosporein
|
Molecular Formula | C14H10O8 | |
IUPAC Name* |
2-(2,5-dihydroxy-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3,6-dihydroxy-5-methylcyclohexa-2,5-diene-1,4-dione
|
|
SMILES |
CC1=C(C(=O)C(=C(C1=O)O)C2=C(C(=O)C(=C(C2=O)O)C)O)O
|
|
InChI |
InChI=1S/C14H10O8/c1-3-7(15)11(19)5(12(20)8(3)16)6-13(21)9(17)4(2)10(18)14(6)22/h15,17,20,22H,1-2H3
|
|
InChIKey |
DHMPJEGFPQTNFX-UHFFFAOYSA-N
|
|
Synonyms |
Oosporein; 475-54-7; Chaetomidin; OOSPORIN; NSC88466; 3,3',6,6'-Tetrahydroxy-5,5'-dimethyl-2,2'-bi-p-benzoquinone; MLS002694850; 708AUK232A; NSC-88466; 2,2'-Bi-p-benzoquinone, 3,3',6,6'-tetrahydroxy-5,5'-dimethyl-; (Bi-1,4-cyclohexadien-1-yl)-3,3',6,6'-tetrone, 2,2',5,5'-tetrahydroxy-4,4'-dimethyl-; [Bi-1,4-cyclohexadien-1-yl]-3,3',6,6'-tetrone, 2,2',5,5'-tetrahydroxy-4,4'-dimethyl-; 2,2',5,5'-Tetrahydroxy-4,4'-dimethyl(bi-1,4-cyclohexadien-1-yl)-3,3',6,6'-tetrone; 2-(2,5-dihydroxy-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3,6-dihydroxy-5-methylcyclohexa-2,5-diene-1,4-dione; NSC 88466; BRN 1892735; UNII-708AUK232A; ISO-OOSPOREIN; OOSPOREIN [MI]; 4-08-00-03742 (Beilstein Handbook Reference); SCHEMBL1097952; CHEMBL1733061; DTXSID80963861; HY-N7719; ZINC84559543; BS-1604; NCGC00246895-01; NCI60_041960; CS-0135680; Oosporein; Isoosporin; Chaetomidin; NSC-88466; Q27265843; [Bi-1,3',6,6'-tetrone, 2,2',5,5'-tetrahydroxy-4,4'-dimethyl-; Dicyclohexyl-2,2',3,3',5,5',6,6'-octaone, 4,4'-dimethyl-; 3,3',6,6'-tetrahydroxy-4,4'-dimethyl-1,1'-bi(cyclohexa-3,6-diene)-2,2',5,5'- tetraone; 2-(2,5-dihydroxy-4-methyl-3,6-dioxo-cyclohexa-1,4-dien-1-yl)-3,6-dihydroxy-5-methyl-1,4-benzoquinone
|
|
CAS | 475-54-7 | |
PubChem CID | 135426831 | |
ChEMBL ID | CHEMBL1733061 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 306.22 | ALogp: | 0.0 |
HBD: | 4 | HBA: | 8 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 149.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 22 | QED Weighted: | 0.523 |
Caco-2 Permeability: | -5.248 | MDCK Permeability: | 0.00013592 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.295 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.976 |
Blood-Brain-Barrier Penetration (BBB): | 0.073 | Plasma Protein Binding (PPB): | 56.34% |
Volume Distribution (VD): | 0.97 | Fu: | 22.31% |
CYP1A2-inhibitor: | 0.063 | CYP1A2-substrate: | 0.136 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.061 |
CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.172 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.088 |
CYP3A4-inhibitor: | 0.005 | CYP3A4-substrate: | 0.023 |
Clearance (CL): | 1.202 | Half-life (T1/2): | 0.236 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.081 |
Drug-inuced Liver Injury (DILI): | 0.934 | AMES Toxicity: | 0.49 |
Rat Oral Acute Toxicity: | 0.035 | Maximum Recommended Daily Dose: | 0.025 |
Skin Sensitization: | 0.881 | Carcinogencity: | 0.016 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.058 |
Respiratory Toxicity: | 0.112 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000670 | ![]() |
0.391 | D0WY9N | ![]() |
0.252 | ||
ENC000116 | ![]() |
0.387 | D07JHH | ![]() |
0.224 | ||
ENC003525 | ![]() |
0.369 | D0H1AR | ![]() |
0.217 | ||
ENC000822 | ![]() |
0.356 | D0R9WP | ![]() |
0.217 | ||
ENC001362 | ![]() |
0.344 | D0R6RC | ![]() |
0.214 | ||
ENC000335 | ![]() |
0.318 | D08LTU | ![]() |
0.212 | ||
ENC003923 | ![]() |
0.309 | D0K8KX | ![]() |
0.208 | ||
ENC003970 | ![]() |
0.309 | D08NQZ | ![]() |
0.207 | ||
ENC001929 | ![]() |
0.300 | D0S0LZ | ![]() |
0.207 | ||
ENC000935 | ![]() |
0.300 | D0J2NK | ![]() |
0.203 |