![]() |
Name |
Trichoacorenol B
|
Molecular Formula | C15H26O2 | |
IUPAC Name* |
(1S,4S,5S,9R)-8-(hydroxymethyl)-1-methyl-4-propan-2-ylspiro[4.5]dec-7-en-9-ol
|
|
SMILES |
C[C@H]1CC[C@H]([C@]12CC=C([C@@H](C2)O)CO)C(C)C
|
|
InChI |
InChI=1S/C15H26O2/c1-10(2)13-5-4-11(3)15(13)7-6-12(9-16)14(17)8-15/h6,10-11,13-14,16-17H,4-5,7-9H2,1-3H3/t11-,13-,14+,15-/m0/s1
|
|
InChIKey |
MTFXKUDGSGWVIS-MHEUCROKSA-N
|
|
Synonyms |
Trichoacorenol B
|
|
CAS | NA | |
PubChem CID | 139591328 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 238.37 | ALogp: | 3.2 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.722 |
Caco-2 Permeability: | -4.419 | MDCK Permeability: | 0.00000822 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.329 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.996 |
30% Bioavailability (F30%): | 0.99 |
Blood-Brain-Barrier Penetration (BBB): | 0.51 | Plasma Protein Binding (PPB): | 63.22% |
Volume Distribution (VD): | 1.218 | Fu: | 21.00% |
CYP1A2-inhibitor: | 0.094 | CYP1A2-substrate: | 0.123 |
CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.749 |
CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.069 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.123 |
CYP3A4-inhibitor: | 0.116 | CYP3A4-substrate: | 0.246 |
Clearance (CL): | 8.803 | Half-life (T1/2): | 0.472 |
hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.189 |
Drug-inuced Liver Injury (DILI): | 0.24 | AMES Toxicity: | 0.074 |
Rat Oral Acute Toxicity: | 0.592 | Maximum Recommended Daily Dose: | 0.954 |
Skin Sensitization: | 0.897 | Carcinogencity: | 0.925 |
Eye Corrosion: | 0.594 | Eye Irritation: | 0.949 |
Respiratory Toxicity: | 0.957 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004827 | ![]() |
0.468 | D04CSZ | ![]() |
0.316 | ||
ENC003947 | ![]() |
0.446 | D08SVH | ![]() |
0.231 | ||
ENC004826 | ![]() |
0.444 | D0Y7LD | ![]() |
0.229 | ||
ENC003908 | ![]() |
0.424 | D07DVK | ![]() |
0.222 | ||
ENC003907 | ![]() |
0.424 | D0IT2G | ![]() |
0.222 | ||
ENC001831 | ![]() |
0.381 | D0CW1P | ![]() |
0.222 | ||
ENC005118 | ![]() |
0.362 | D05BTM | ![]() |
0.219 | ||
ENC004004 | ![]() |
0.343 | D0G5CF | ![]() |
0.219 | ||
ENC002392 | ![]() |
0.338 | D0T2PL | ![]() |
0.219 | ||
ENC000786 | ![]() |
0.338 | D0K5WS | ![]() |
0.216 |