![]() |
Name |
Acaciicolinol I
|
Molecular Formula | C15H24O3 | |
IUPAC Name* |
(1R,6S,10S)-10-hydroxy-9-(hydroxymethyl)-1,5,5-trimethylspiro[5.5]undec-8-en-2-one
|
|
SMILES |
C[C@H]1C(=O)CCC([C@]12CC=C([C@H](C2)O)CO)(C)C
|
|
InChI |
InChI=1S/C15H24O3/c1-10-12(17)5-6-14(2,3)15(10)7-4-11(9-16)13(18)8-15/h4,10,13,16,18H,5-9H2,1-3H3/t10-,13-,15-/m0/s1
|
|
InChIKey |
IGRNLIKXFWTOFX-XEGUGMAKSA-N
|
|
Synonyms |
Acaciicolinol I
|
|
CAS | NA | |
PubChem CID | 139590768 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 252.35 | ALogp: | 1.5 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.705 |
Caco-2 Permeability: | -4.483 | MDCK Permeability: | 0.00001130 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.732 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.977 |
30% Bioavailability (F30%): | 0.959 |
Blood-Brain-Barrier Penetration (BBB): | 0.271 | Plasma Protein Binding (PPB): | 52.63% |
Volume Distribution (VD): | 0.945 | Fu: | 59.57% |
CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.148 |
CYP2C19-inhibitor: | 0.01 | CYP2C19-substrate: | 0.742 |
CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.159 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.172 |
CYP3A4-inhibitor: | 0.044 | CYP3A4-substrate: | 0.217 |
Clearance (CL): | 8.307 | Half-life (T1/2): | 0.858 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.146 |
Drug-inuced Liver Injury (DILI): | 0.41 | AMES Toxicity: | 0.078 |
Rat Oral Acute Toxicity: | 0.929 | Maximum Recommended Daily Dose: | 0.945 |
Skin Sensitization: | 0.36 | Carcinogencity: | 0.941 |
Eye Corrosion: | 0.143 | Eye Irritation: | 0.764 |
Respiratory Toxicity: | 0.911 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0CZ1Q | ![]() |
0.274 | ||||
![]() |
D08PIQ | ![]() |
0.274 | ||||
![]() |
D0L2LS | ![]() |
0.270 | ||||
![]() |
D0IT2G | ![]() |
0.268 | ||||
![]() |
D0CW1P | ![]() |
0.268 | ||||
![]() |
D07DVK | ![]() |
0.268 | ||||
![]() |
D0D1SG | ![]() |
0.266 | ||||
![]() |
D0KR5B | ![]() |
0.266 | ||||
![]() |
D0G6AB | ![]() |
0.264 | ||||
![]() |
D04SFH | ![]() |
0.261 |