![]() |
Name |
Trichocadinin F
|
Molecular Formula | C15H24O3 | |
IUPAC Name* |
(4aR,5R,8R,8aS)-4a-hydroxy-5-methyl-8-propan-2-yl-4,5,6,7,8,8a-hexahydro-3H-naphthalene-2-carboxylic acid
|
|
SMILES |
C[C@@H]1CC[C@@H]([C@@H]2[C@]1(CCC(=C2)C(=O)O)O)C(C)C
|
|
InChI |
InChI=1S/C15H24O3/c1-9(2)12-5-4-10(3)15(18)7-6-11(14(16)17)8-13(12)15/h8-10,12-13,18H,4-7H2,1-3H3,(H,16,17)/t10-,12-,13-,15-/m1/s1
|
|
InChIKey |
ISNQOHCTTZIKKK-BPGGGUHBSA-N
|
|
Synonyms |
Trichocadinin F; CHEMBL4455407
|
|
CAS | NA | |
PubChem CID | 145721093 | |
ChEMBL ID | CHEMBL4455407 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 252.35 | ALogp: | 3.0 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.789 |
Caco-2 Permeability: | -4.621 | MDCK Permeability: | 0.00001750 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.252 | Plasma Protein Binding (PPB): | 93.65% |
Volume Distribution (VD): | 0.478 | Fu: | 5.33% |
CYP1A2-inhibitor: | 0.088 | CYP1A2-substrate: | 0.418 |
CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.454 |
CYP2C9-inhibitor: | 0.2 | CYP2C9-substrate: | 0.676 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.197 |
CYP3A4-inhibitor: | 0.037 | CYP3A4-substrate: | 0.185 |
Clearance (CL): | 4.615 | Half-life (T1/2): | 0.659 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.639 |
Drug-inuced Liver Injury (DILI): | 0.091 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.045 | Maximum Recommended Daily Dose: | 0.102 |
Skin Sensitization: | 0.926 | Carcinogencity: | 0.067 |
Eye Corrosion: | 0.064 | Eye Irritation: | 0.952 |
Respiratory Toxicity: | 0.79 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004008 | ![]() |
0.469 | D04CSZ | ![]() |
0.351 | ||
ENC005090 | ![]() |
0.452 | D04GJN | ![]() |
0.247 | ||
ENC004007 | ![]() |
0.412 | D0I2SD | ![]() |
0.247 | ||
ENC002017 | ![]() |
0.400 | D01CKY | ![]() |
0.245 | ||
ENC004313 | ![]() |
0.380 | D03KEK | ![]() |
0.237 | ||
ENC004025 | ![]() |
0.379 | D0I5DS | ![]() |
0.235 | ||
ENC003050 | ![]() |
0.368 | D04SFH | ![]() |
0.234 | ||
ENC004919 | ![]() |
0.366 | D04ATM | ![]() |
0.232 | ||
ENC002278 | ![]() |
0.357 | D06PSS | ![]() |
0.231 | ||
ENC004664 | ![]() |
0.357 | D07QKN | ![]() |
0.231 |