|
Name |
Penochalasin I
|
Molecular Formula | C32H36N2O4 | |
IUPAC Name* |
(1S,6R,7E,9S,11E,13R,16R,27S,30R)-6-hydroxy-7,9,16,30-tetramethyl-18,28-diazahexacyclo[14.13.1.01,13.017,25.019,24.027,30]triaconta-3,7,11,17(25),19,21,23-heptaene-2,5,29-trione
|
|
SMILES |
C[C@H]\1C/C=C/[C@H]2CC[C@]3(C4=C(C[C@H]5[C@]3([C@@]2(C(=O)C=CC(=O)[C@@H](/C(=C1)/C)O)C(=O)N5)C)C6=CC=CC=C6N4)C
|
|
InChI |
InChI=1S/C32H36N2O4/c1-18-8-7-9-20-14-15-30(3)28-22(21-10-5-6-11-23(21)33-28)17-25-31(30,4)32(20,29(38)34-25)26(36)13-12-24(35)27(37)19(2)16-18/h5-7,9-13,16,18,20,25,27,33,37H,8,14-15,17H2,1-4H3,(H,34,38)/b9-7+,13-12?,19-16+/t18-,20-,25-,27+,30-,31+,32-/m0/s1
|
|
InChIKey |
CNOXPHKUUAMNSN-VXHPOFCZSA-N
|
|
Synonyms |
Penochalasin I
|
|
CAS | NA | |
PubChem CID | 139590394 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 512.6 | ALogp: | 4.7 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 99.3 | Aromatic Rings: | 6 |
Heavy Atoms: | 38 | QED Weighted: | 0.342 |
Caco-2 Permeability: | -4.959 | MDCK Permeability: | 0.00002210 |
Pgp-inhibitor: | 0.994 | Pgp-substrate: | 0.205 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.081 |
30% Bioavailability (F30%): | 0.268 |
Blood-Brain-Barrier Penetration (BBB): | 0.256 | Plasma Protein Binding (PPB): | 97.57% |
Volume Distribution (VD): | 0.278 | Fu: | 1.31% |
CYP1A2-inhibitor: | 0.087 | CYP1A2-substrate: | 0.781 |
CYP2C19-inhibitor: | 0.862 | CYP2C19-substrate: | 0.679 |
CYP2C9-inhibitor: | 0.807 | CYP2C9-substrate: | 0.91 |
CYP2D6-inhibitor: | 0.459 | CYP2D6-substrate: | 0.24 |
CYP3A4-inhibitor: | 0.944 | CYP3A4-substrate: | 0.707 |
Clearance (CL): | 2.932 | Half-life (T1/2): | 0.27 |
hERG Blockers: | 0.052 | Human Hepatotoxicity (H-HT): | 0.407 |
Drug-inuced Liver Injury (DILI): | 0.079 | AMES Toxicity: | 0.299 |
Rat Oral Acute Toxicity: | 0.974 | Maximum Recommended Daily Dose: | 0.929 |
Skin Sensitization: | 0.225 | Carcinogencity: | 0.77 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.965 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004473 | 0.503 | D05MQK | 0.275 | ||||
ENC002120 | 0.500 | D01HTL | 0.267 | ||||
ENC003226 | 0.497 | D01TSI | 0.265 | ||||
ENC002440 | 0.486 | D04RLY | 0.262 | ||||
ENC004308 | 0.483 | D06CWH | 0.258 | ||||
ENC006149 | 0.453 | D01JGV | 0.257 | ||||
ENC003245 | 0.442 | D0U7GP | 0.257 | ||||
ENC003586 | 0.433 | D08VRO | 0.252 | ||||
ENC002681 | 0.417 | D0V3ZA | 0.251 | ||||
ENC003856 | 0.409 | D0OT9S | 0.250 |