![]() |
Name |
1'-O-Acetylpaxilline
|
Molecular Formula | C29H35NO5 | |
IUPAC Name* |
2-[(1S,2R,5S,7R,11S,14S)-11-hydroxy-1,2-dimethyl-8-oxo-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaen-7-yl]propan-2-yl acetate
|
|
SMILES |
CC(=O)OC(C)(C)[C@@H]1C(=O)C=C2[C@@H](O1)CC[C@]3([C@]2(CC[C@@H]4[C@@]3(C5=C(C4)C6=CC=CC=C6N5)C)O)C
|
|
InChI |
InChI=1S/C29H35NO5/c1-16(31)35-26(2,3)25-22(32)15-20-23(34-25)11-12-27(4)28(5)17(10-13-29(20,27)33)14-19-18-8-6-7-9-21(18)30-24(19)28/h6-9,15,17,23,25,30,33H,10-14H2,1-5H3/t17-,23-,25-,27+,28+,29+/m0/s1
|
|
InChIKey |
OHPVFSRTGKOAHP-FPCGACKZSA-N
|
|
Synonyms |
1'-O-Acetylpaxilline; 121998-08-1; P2WL8YH7EG; 2-[(1S,2R,5S,7R,11S,14S)-11-hydroxy-1,2-dimethyl-8-oxo-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaen-7-yl]propan-2-yl acetate; UNII-P2WL8YH7EG; DTXSID40924039; CHEBI:186023; (2R,4BS,6AS,12BS,12CR,14AS)-2-(1-(ACETYLOXY)-1-METHYLETHYL)-5,6,6A,7,12,12B,12C,13,14,14A-DECAHYDRO-4B-HYDROXY-12B,12C-DIMETHYL-2H-1-BENZOPYRANO(5',6':6,7)INDENO(1,2-B)INDOL-3(4BH)-ONE; 2-(4b-Hydroxy-12b,12c-dimethyl-3-oxo-3,4b,5,6,6a,7,12,12b,12c,13,14,14a-dodecahydro-2H-[1]benzopyrano[5',6':6,7]indeno[1,2-b]indol-2-yl)propan-2-yl acetate; 2H-1-BENZOPYRANO(5',6':6,7)INDENO(1,2-B)INDOL-3(4BH)-ONE, 2-(1-(ACETYLOXY)-1-METHYLETHYL)-5,6,6A,7,12,12B,12C,13,14,14A-DECAHYDRO-4B-HYDROXY-12B,12C-DIMETHYL-, (2R,4BS,6AS,12BS,12CR,14AS)-; 2H-1-Benzopyrano(5',6':6,7)indeno(1,2-b)indol-3(4bH)-one, 2-(1-(acetyloxy)-1-methylethyl)-5,6,6a,7,12,12b,12c,13,14,14a-decahydro-4b-hydroxy-12b,12c-dimethyl-, (2R-(2alpha,4bbeta,6aalpha,12bbeta,12calpha,14abeta))-
|
|
CAS | 121998-08-1 | |
PubChem CID | 3081700 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 477.6 | ALogp: | 3.5 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 88.6 | Aromatic Rings: | 6 |
Heavy Atoms: | 35 | QED Weighted: | 0.594 |
Caco-2 Permeability: | -4.977 | MDCK Permeability: | 0.00002390 |
Pgp-inhibitor: | 0.612 | Pgp-substrate: | 0.921 |
Human Intestinal Absorption (HIA): | 0.024 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.961 |
Blood-Brain-Barrier Penetration (BBB): | 0.959 | Plasma Protein Binding (PPB): | 83.50% |
Volume Distribution (VD): | 0.769 | Fu: | 11.20% |
CYP1A2-inhibitor: | 0.272 | CYP1A2-substrate: | 0.744 |
CYP2C19-inhibitor: | 0.756 | CYP2C19-substrate: | 0.751 |
CYP2C9-inhibitor: | 0.764 | CYP2C9-substrate: | 0.141 |
CYP2D6-inhibitor: | 0.179 | CYP2D6-substrate: | 0.084 |
CYP3A4-inhibitor: | 0.926 | CYP3A4-substrate: | 0.918 |
Clearance (CL): | 6.917 | Half-life (T1/2): | 0.336 |
hERG Blockers: | 0.07 | Human Hepatotoxicity (H-HT): | 0.328 |
Drug-inuced Liver Injury (DILI): | 0.592 | AMES Toxicity: | 0.278 |
Rat Oral Acute Toxicity: | 0.963 | Maximum Recommended Daily Dose: | 0.923 |
Skin Sensitization: | 0.863 | Carcinogencity: | 0.897 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.989 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000836 | ![]() |
0.824 | D0H4JM | ![]() |
0.293 | ||
ENC005990 | ![]() |
0.603 | D0U7GP | ![]() |
0.293 | ||
ENC005988 | ![]() |
0.602 | D01JGV | ![]() |
0.293 | ||
ENC005405 | ![]() |
0.600 | D0V4WD | ![]() |
0.274 | ||
ENC002279 | ![]() |
0.600 | D0OT9S | ![]() |
0.273 | ||
ENC001966 | ![]() |
0.512 | D04GJN | ![]() |
0.269 | ||
ENC002951 | ![]() |
0.504 | D01HTL | ![]() |
0.266 | ||
ENC003172 | ![]() |
0.496 | D0K0KH | ![]() |
0.264 | ||
ENC005989 | ![]() |
0.496 | D06AEO | ![]() |
0.263 | ||
ENC003834 | ![]() |
0.484 | D04RLY | ![]() |
0.261 |