![]() |
Name |
Drechmerin E
|
Molecular Formula | C32H43NO7 | |
IUPAC Name* |
(1R)-1-[(1R,2S,13S,16S,17S,19R,20R,22S,25S,27S)-16-hydroxy-1,2,24,24-tetramethyl-18,21,23,26-tetraoxa-4-azaoctacyclo[14.13.0.02,13.03,11.05,10.017,19.017,27.020,25]nonacosa-3(11),5,7,9-tetraen-22-yl]-2-methylpropane-1,2-diol
|
|
SMILES |
C[C@]12CC[C@H]3[C@@]4([C@@]1(CC[C@@H]5[C@@]2(C6=C(C5)C7=CC=CC=C7N6)C)O)[C@H](O4)[C@H]8[C@H](O3)C(O[C@H](O8)[C@@H](C(C)(C)O)O)(C)C
|
|
InChI |
InChI=1S/C32H43NO7/c1-27(2,35)23(34)26-38-21-24(28(3,4)40-26)37-20-12-13-29(5)30(6)16(11-14-31(29,36)32(20)25(21)39-32)15-18-17-9-7-8-10-19(17)33-22(18)30/h7-10,16,20-21,23-26,33-36H,11-15H2,1-6H3/t16-,20-,21+,23-,24-,25+,26-,29+,30+,31-,32-/m0/s1
|
|
InChIKey |
NPOBYPOTVIAKCY-CJBOXUOYSA-N
|
|
Synonyms |
Drechmerin E
|
|
CAS | NA | |
PubChem CID | 139590919 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 553.7 | ALogp: | 2.8 |
HBD: | 4 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 117.0 | Aromatic Rings: | 8 |
Heavy Atoms: | 40 | QED Weighted: | 0.412 |
Caco-2 Permeability: | -5.285 | MDCK Permeability: | 0.00001180 |
Pgp-inhibitor: | 0.99 | Pgp-substrate: | 0.983 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.712 |
Blood-Brain-Barrier Penetration (BBB): | 0.579 | Plasma Protein Binding (PPB): | 81.71% |
Volume Distribution (VD): | 1.045 | Fu: | 15.65% |
CYP1A2-inhibitor: | 0.024 | CYP1A2-substrate: | 0.9 |
CYP2C19-inhibitor: | 0.045 | CYP2C19-substrate: | 0.733 |
CYP2C9-inhibitor: | 0.188 | CYP2C9-substrate: | 0.041 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.386 |
CYP3A4-inhibitor: | 0.441 | CYP3A4-substrate: | 0.618 |
Clearance (CL): | 3.835 | Half-life (T1/2): | 0.216 |
hERG Blockers: | 0.837 | Human Hepatotoxicity (H-HT): | 0.582 |
Drug-inuced Liver Injury (DILI): | 0.065 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.969 | Maximum Recommended Daily Dose: | 0.941 |
Skin Sensitization: | 0.312 | Carcinogencity: | 0.936 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.991 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003931 | ![]() |
1.000 | D0H4JM | ![]() |
0.248 | ||
ENC002013 | ![]() |
0.772 | D0KR9U | ![]() |
0.227 | ||
ENC003787 | ![]() |
0.760 | D04RLY | ![]() |
0.227 | ||
ENC001966 | ![]() |
0.692 | D01JGV | ![]() |
0.224 | ||
ENC003929 | ![]() |
0.560 | D0U7GP | ![]() |
0.224 | ||
ENC003834 | ![]() |
0.546 | D0OT9S | ![]() |
0.222 | ||
ENC000836 | ![]() |
0.493 | D0H2JP | ![]() |
0.220 | ||
ENC004710 | ![]() |
0.493 | D06AWE | ![]() |
0.220 | ||
ENC005557 | ![]() |
0.491 | D02IQY | ![]() |
0.217 | ||
ENC000857 | ![]() |
0.489 | D0W9MM | ![]() |
0.216 |