![]() |
Name |
(3E,5E,8S,11E,13E,16S)-8,16-bis[(E,2S,3R,4S,8R,9R)-8-ethyl-3,9-dihydroxy-4-methyl-5-oxodec-6-en-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione
|
Molecular Formula | C42H64O10 | |
IUPAC Name* |
(3E,5E,8S,11E,13E,16S)-8,16-bis[(E,2S,3R,4S,8R,9R)-8-ethyl-3,9-dihydroxy-4-methyl-5-oxodec-6-en-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione
|
|
SMILES |
CC[C@@H]([C@H](O)C)/C=C/C(=O)[C@H]([C@H](O)[C@@H]([C@H]1OC(=O)/C=C/C=C/C([C@H](OC(=O)/C=C/C=C/C1C)[C@H]([C@@H](O)[C@@H](C(=O)/C=C/[C@H]([C@H](O)C)CC)C)C)C)C)C
|
|
InChI |
InChI=1S/C42H64O10/c1-11-33(31(9)43)21-23-35(45)27(5)39(49)29(7)41-25(3)17-13-15-20-38(48)52-42(26(4)18-14-16-19-37(47)51-41)30(8)40(50)28(6)36(46)24-22-34(12-2)32(10)44/h13-34,39-44,49-50H,11-12H2,1-10H3/b17-13+,18-14+,19-16+,20-15+,23-21+,24-22+/t25?,26?,27-,28-,29+,30+,31-,32-,33-,34-,39+,40+,41+,42+/m1/s1
|
|
InChIKey |
JVUXDWXWTYQXKG-AHYPAQGRSA-N
|
|
Synonyms |
Efomycin M
|
|
CAS | NA | |
PubChem CID | 14634401 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 728.9 | ALogp: | 6.8 |
HBD: | 4 | HBA: | 10 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 168.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 52 | QED Weighted: | 0.113 |
Caco-2 Permeability: | -4.901 | MDCK Permeability: | 0.00003390 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.937 |
Human Intestinal Absorption (HIA): | 0.968 | 20% Bioavailability (F20%): | 0.163 |
30% Bioavailability (F30%): | 0.979 |
Blood-Brain-Barrier Penetration (BBB): | 0.037 | Plasma Protein Binding (PPB): | 96.50% |
Volume Distribution (VD): | 2.216 | Fu: | 3.14% |
CYP1A2-inhibitor: | 0.032 | CYP1A2-substrate: | 0.028 |
CYP2C19-inhibitor: | 0.009 | CYP2C19-substrate: | 0.788 |
CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.107 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.041 |
CYP3A4-inhibitor: | 0.824 | CYP3A4-substrate: | 0.838 |
Clearance (CL): | 2.9 | Half-life (T1/2): | 0.441 |
hERG Blockers: | 0.411 | Human Hepatotoxicity (H-HT): | 0.567 |
Drug-inuced Liver Injury (DILI): | 0.176 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.649 | Maximum Recommended Daily Dose: | 0.964 |
Skin Sensitization: | 0.528 | Carcinogencity: | 0.442 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.97 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003127 | ![]() |
0.365 | D02RQU | ![]() |
0.190 | ||
ENC003155 | ![]() |
0.344 | D0X1WJ | ![]() |
0.185 | ||
ENC005725 | ![]() |
0.269 | D05AFC | ![]() |
0.185 | ||
ENC003821 | ![]() |
0.254 | D0J7OG | ![]() |
0.182 | ||
ENC004261 | ![]() |
0.253 | D0L6QI | ![]() |
0.180 | ||
ENC004257 | ![]() |
0.253 | D0FX2Q | ![]() |
0.178 | ||
ENC004260 | ![]() |
0.242 | D04ITO | ![]() |
0.177 | ||
ENC004259 | ![]() |
0.242 | D05CHI | ![]() |
0.174 | ||
ENC003822 | ![]() |
0.241 | D06LNW | ![]() |
0.174 | ||
ENC005724 | ![]() |
0.238 | D06WTZ | ![]() |
0.172 |