![]() |
Name |
Cytochalasin Z27
|
Molecular Formula | C28H33NO6 | |
IUPAC Name* |
(1S,5E,8S,10E,12S,13S,17S)-13-hydroxy-17-[(4-hydroxyphenyl)methyl]-6,8,14,15-tetramethyl-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-5,10,14-triene-3,7,19-trione
|
|
SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H](C(=C(C3[C@]2(C(=O)N[C@H]3CC4=CC=C(C=C4)O)OC(=O)C/C=C(/C1=O)\C)C)C)O
|
|
InChI |
InChI=1S/C28H33NO6/c1-15-6-5-7-21-26(33)18(4)17(3)24-22(14-19-9-11-20(30)12-10-19)29-27(34)28(21,24)35-23(31)13-8-16(2)25(15)32/h5,7-12,15,21-22,24,26,30,33H,6,13-14H2,1-4H3,(H,29,34)/b7-5+,16-8+/t15-,21-,22-,24?,26+,28+/m0/s1
|
|
InChIKey |
CSVPRGBYVKEOJA-OROKRKONSA-N
|
|
Synonyms |
Cytochalasin Z27
|
|
CAS | NA | |
PubChem CID | 139585935 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 479.6 | ALogp: | 2.5 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 35 | QED Weighted: | 0.438 |
Caco-2 Permeability: | -4.929 | MDCK Permeability: | 0.00004430 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.99 |
Human Intestinal Absorption (HIA): | 0.052 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.386 | Plasma Protein Binding (PPB): | 98.30% |
Volume Distribution (VD): | 0.899 | Fu: | 2.31% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.099 |
CYP2C19-inhibitor: | 0.46 | CYP2C19-substrate: | 0.515 |
CYP2C9-inhibitor: | 0.283 | CYP2C9-substrate: | 0.098 |
CYP2D6-inhibitor: | 0.035 | CYP2D6-substrate: | 0.289 |
CYP3A4-inhibitor: | 0.907 | CYP3A4-substrate: | 0.397 |
Clearance (CL): | 11.197 | Half-life (T1/2): | 0.104 |
hERG Blockers: | 0.11 | Human Hepatotoxicity (H-HT): | 0.74 |
Drug-inuced Liver Injury (DILI): | 0.681 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.589 | Maximum Recommended Daily Dose: | 0.941 |
Skin Sensitization: | 0.192 | Carcinogencity: | 0.184 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.941 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004801 | ![]() |
0.810 | D06XZW | ![]() |
0.300 | ||
ENC003802 | ![]() |
0.743 | D0S2BV | ![]() |
0.278 | ||
ENC001865 | ![]() |
0.553 | D04UTT | ![]() |
0.234 | ||
ENC002174 | ![]() |
0.545 | D0SP3D | ![]() |
0.225 | ||
ENC002161 | ![]() |
0.532 | D0S0LZ | ![]() |
0.224 | ||
ENC004469 | ![]() |
0.468 | D09NNH | ![]() |
0.224 | ||
ENC002443 | ![]() |
0.468 | D0V3ZA | ![]() |
0.223 | ||
ENC003335 | ![]() |
0.460 | D01TSI | ![]() |
0.223 | ||
ENC003619 | ![]() |
0.460 | D01XDL | ![]() |
0.220 | ||
ENC005174 | ![]() |
0.460 | D0AZ8C | ![]() |
0.220 |