|
Name |
Macrosphelide C
|
Molecular Formula | C16H22O7 | |
IUPAC Name* |
(4S,7E,10S,13E,15R,16S)-15-hydroxy-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione
|
|
SMILES |
C[C@H]1C/C=C/C(=O)O[C@H](CC(=O)O[C@H]([C@@H](/C=C/C(=O)O1)O)C)C
|
|
InChI |
InChI=1S/C16H22O7/c1-10-5-4-6-14(18)22-11(2)9-16(20)23-12(3)13(17)7-8-15(19)21-10/h4,6-8,10-13,17H,5,9H2,1-3H3/b6-4+,8-7+/t10-,11-,12-,13+/m0/s1
|
|
InChIKey |
LHDGUPDIEZSEGS-HRABQTKNSA-N
|
|
Synonyms |
Macrosphelide C; (4S,7E,10S,13E,15R,16S)-15-hydroxy-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione; 199731-56-1
|
|
CAS | NA | |
PubChem CID | 11198166 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 326.34 | ALogp: | 1.4 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 23 | QED Weighted: | 0.532 |
Caco-2 Permeability: | -4.486 | MDCK Permeability: | 0.00006340 |
Pgp-inhibitor: | 0.713 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.035 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.977 | Plasma Protein Binding (PPB): | 58.95% |
Volume Distribution (VD): | 0.278 | Fu: | 32.99% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.037 |
CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.137 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.132 |
CYP3A4-inhibitor: | 0.212 | CYP3A4-substrate: | 0.24 |
Clearance (CL): | 8.833 | Half-life (T1/2): | 0.94 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.164 |
Drug-inuced Liver Injury (DILI): | 0.519 | AMES Toxicity: | 0.715 |
Rat Oral Acute Toxicity: | 0.029 | Maximum Recommended Daily Dose: | 0.953 |
Skin Sensitization: | 0.946 | Carcinogencity: | 0.848 |
Eye Corrosion: | 0.997 | Eye Irritation: | 0.425 |
Respiratory Toxicity: | 0.039 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003788 | 0.726 | D06WTZ | 0.246 | ||||
ENC005849 | 0.726 | D0H0ND | 0.241 | ||||
ENC001946 | 0.718 | D0K7LU | 0.233 | ||||
ENC005850 | 0.703 | D02FEM | 0.231 | ||||
ENC003456 | 0.452 | D03DIG | 0.214 | ||||
ENC001860 | 0.388 | D0J7OG | 0.213 | ||||
ENC001867 | 0.353 | D0X1WJ | 0.211 | ||||
ENC003403 | 0.353 | D0L6QI | 0.210 | ||||
ENC002189 | 0.342 | D0WE3O | 0.208 | ||||
ENC001414 | 0.333 | D05AFC | 0.206 |