![]() |
Name |
Pestalotioprolide B
|
Molecular Formula | C14H20O5 | |
IUPAC Name* |
(1S,2R,3E,7S,11E,13S,14R)-2,13-dihydroxy-7-methyl-6,15-dioxabicyclo[12.1.0]pentadeca-3,11-dien-5-one
|
|
SMILES |
C[C@H]1CCC/C=C/[C@@H]([C@@H]2[C@@H](O2)[C@@H](/C=C/C(=O)O1)O)O
|
|
InChI |
InChI=1S/C14H20O5/c1-9-5-3-2-4-6-10(15)13-14(19-13)11(16)7-8-12(17)18-9/h4,6-11,13-16H,2-3,5H2,1H3/b6-4+,8-7+/t9-,10-,11+,13+,14-/m0/s1
|
|
InChIKey |
IZTMFEJNMBMWKQ-SMRHDDPZSA-N
|
|
Synonyms |
Pestalotioprolide B; CHEMBL3937794; J3.554.611A
|
|
CAS | NA | |
PubChem CID | 132525149 | |
ChEMBL ID | CHEMBL3937794 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 268.3 | ALogp: | 0.7 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 79.3 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.391 |
Caco-2 Permeability: | -4.726 | MDCK Permeability: | 0.00007830 |
Pgp-inhibitor: | 0.16 | Pgp-substrate: | 0.037 |
Human Intestinal Absorption (HIA): | 0.296 | 20% Bioavailability (F20%): | 0.076 |
30% Bioavailability (F30%): | 0.98 |
Blood-Brain-Barrier Penetration (BBB): | 0.975 | Plasma Protein Binding (PPB): | 70.55% |
Volume Distribution (VD): | 0.68 | Fu: | 27.03% |
CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.083 |
CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.112 |
CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.673 |
CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.349 |
CYP3A4-inhibitor: | 0.056 | CYP3A4-substrate: | 0.176 |
Clearance (CL): | 6.408 | Half-life (T1/2): | 0.855 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.425 |
Drug-inuced Liver Injury (DILI): | 0.372 | AMES Toxicity: | 0.024 |
Rat Oral Acute Toxicity: | 0.684 | Maximum Recommended Daily Dose: | 0.878 |
Skin Sensitization: | 0.238 | Carcinogencity: | 0.885 |
Eye Corrosion: | 0.036 | Eye Irritation: | 0.074 |
Respiratory Toxicity: | 0.097 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001867 | ![]() |
1.000 | D0WE3O | ![]() |
0.228 | ||
ENC005098 | ![]() |
0.627 | D02FEM | ![]() |
0.228 | ||
ENC004599 | ![]() |
0.627 | D05ZJG | ![]() |
0.216 | ||
ENC004602 | ![]() |
0.627 | D0B7YT | ![]() |
0.208 | ||
ENC002215 | ![]() |
0.627 | D03DIG | ![]() |
0.208 | ||
ENC004603 | ![]() |
0.609 | D02KIE | ![]() |
0.208 | ||
ENC005407 | ![]() |
0.585 | D0M6VK | ![]() |
0.204 | ||
ENC001860 | ![]() |
0.557 | D04LHJ | ![]() |
0.202 | ||
ENC003835 | ![]() |
0.514 | D02PCR | ![]() |
0.202 | ||
ENC002189 | ![]() |
0.508 | D0CZ1Q | ![]() |
0.200 |