![]() |
Name |
2,8-Dimethoxy-1,6-dimethoxycarbonyl-xanthen-9-one
|
Molecular Formula | C19H16O8 | |
IUPAC Name* |
dimethyl 2,8-dimethoxy-9-oxoxanthene-1,6-dicarboxylate
|
|
SMILES |
COC1=C(C2=C(C=C1)OC3=C(C2=O)C(=CC(=C3)C(=O)OC)OC)C(=O)OC
|
|
InChI |
InChI=1S/C19H16O8/c1-23-10-5-6-11-15(16(10)19(22)26-4)17(20)14-12(24-2)7-9(18(21)25-3)8-13(14)27-11/h5-8H,1-4H3
|
|
InChIKey |
JJGQDIBMHJAORS-UHFFFAOYSA-N
|
|
Synonyms |
2,8-dimethoxy-1,6-dimethoxycarbonyl-xanthen-9-one
|
|
CAS | NA | |
PubChem CID | 139584386 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 372.3 | ALogp: | 2.6 |
HBD: | 0 | HBA: | 8 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 97.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 27 | QED Weighted: | 0.508 |
Caco-2 Permeability: | -4.726 | MDCK Permeability: | 0.00006130 |
Pgp-inhibitor: | 0.989 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.189 |
Blood-Brain-Barrier Penetration (BBB): | 0.515 | Plasma Protein Binding (PPB): | 71.21% |
Volume Distribution (VD): | 0.979 | Fu: | 21.20% |
CYP1A2-inhibitor: | 0.809 | CYP1A2-substrate: | 0.984 |
CYP2C19-inhibitor: | 0.874 | CYP2C19-substrate: | 0.465 |
CYP2C9-inhibitor: | 0.844 | CYP2C9-substrate: | 0.913 |
CYP2D6-inhibitor: | 0.233 | CYP2D6-substrate: | 0.726 |
CYP3A4-inhibitor: | 0.561 | CYP3A4-substrate: | 0.166 |
Clearance (CL): | 5.384 | Half-life (T1/2): | 0.751 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.14 |
Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.285 |
Rat Oral Acute Toxicity: | 0.018 | Maximum Recommended Daily Dose: | 0.061 |
Skin Sensitization: | 0.162 | Carcinogencity: | 0.014 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.757 |
Respiratory Toxicity: | 0.066 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002404 | ![]() |
0.772 | D06GCK | ![]() |
0.388 | ||
ENC002148 | ![]() |
0.506 | D09DHY | ![]() |
0.363 | ||
ENC001749 | ![]() |
0.489 | D02LZB | ![]() |
0.342 | ||
ENC002135 | ![]() |
0.473 | D0NJ3V | ![]() |
0.318 | ||
ENC004289 | ![]() |
0.473 | D0A8FB | ![]() |
0.310 | ||
ENC005167 | ![]() |
0.464 | D01FFA | ![]() |
0.310 | ||
ENC002668 | ![]() |
0.457 | D04OSE | ![]() |
0.306 | ||
ENC005168 | ![]() |
0.450 | D09HDR | ![]() |
0.304 | ||
ENC006013 | ![]() |
0.435 | D0J4JM | ![]() |
0.303 | ||
ENC003136 | ![]() |
0.427 | D06TQZ | ![]() |
0.297 |