![]() |
Name |
2-hydroxy-6-(hydroxymethyl)-8-methoxy-9-oxo-xanthene-1-carboxylic Acid
|
Molecular Formula | C16H12O7 | |
IUPAC Name* |
2-hydroxy-6-(hydroxymethyl)-8-methoxy-9-oxoxanthene-1-carboxylic acid
|
|
SMILES |
COC1=CC(=CC2=C1C(=O)C3=C(O2)C=CC(=C3C(=O)O)O)CO
|
|
InChI |
InChI=1S/C16H12O7/c1-22-10-4-7(6-17)5-11-13(10)15(19)14-9(23-11)3-2-8(18)12(14)16(20)21/h2-5,17-18H,6H2,1H3,(H,20,21)
|
|
InChIKey |
WKVDGQDBUCFWBJ-UHFFFAOYSA-N
|
|
Synonyms |
CHEMBL590883; 2-hydroxy-6-(hydroxymethyl)-8-methoxy-9-oxo-9H-xanthene-1-carboxylic acid; BDBM50339595; 2-hydroxy-6-(hydroxymethyl)-8-methoxy-9-oxo-xanthene-1-carboxylic Acid; 2-hydroxy-6-hydroxymethyl-8-methoxy-9-oxo-9h-xanthene-1-carboxylic acid
|
|
CAS | NA | |
PubChem CID | 11278507 | |
ChEMBL ID | CHEMBL590883 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 316.26 | ALogp: | 1.8 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.635 |
Caco-2 Permeability: | -5.259 | MDCK Permeability: | 0.00001890 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.975 |
Human Intestinal Absorption (HIA): | 0.56 | 20% Bioavailability (F20%): | 0.04 |
30% Bioavailability (F30%): | 0.99 |
Blood-Brain-Barrier Penetration (BBB): | 0.236 | Plasma Protein Binding (PPB): | 82.54% |
Volume Distribution (VD): | 1.213 | Fu: | 15.26% |
CYP1A2-inhibitor: | 0.349 | CYP1A2-substrate: | 0.848 |
CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.089 |
CYP2C9-inhibitor: | 0.057 | CYP2C9-substrate: | 0.696 |
CYP2D6-inhibitor: | 0.096 | CYP2D6-substrate: | 0.171 |
CYP3A4-inhibitor: | 0.111 | CYP3A4-substrate: | 0.07 |
Clearance (CL): | 3.646 | Half-life (T1/2): | 0.857 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.103 |
Drug-inuced Liver Injury (DILI): | 0.511 | AMES Toxicity: | 0.421 |
Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.76 |
Skin Sensitization: | 0.386 | Carcinogencity: | 0.35 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.699 |
Respiratory Toxicity: | 0.895 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002148 | ![]() |
0.783 | D06GCK | ![]() |
0.347 | ||
ENC002668 | ![]() |
0.726 | D0K8KX | ![]() |
0.337 | ||
ENC004289 | ![]() |
0.597 | D04AIT | ![]() |
0.330 | ||
ENC002469 | ![]() |
0.590 | D0G5UB | ![]() |
0.323 | ||
ENC001749 | ![]() |
0.577 | D07MGA | ![]() |
0.319 | ||
ENC002690 | ![]() |
0.556 | D0QD1G | ![]() |
0.313 | ||
ENC003785 | ![]() |
0.518 | D0G7IY | ![]() |
0.306 | ||
ENC002404 | ![]() |
0.518 | D06NSS | ![]() |
0.306 | ||
ENC004886 | ![]() |
0.513 | D0Z3DY | ![]() |
0.278 | ||
ENC002284 | ![]() |
0.513 | D0S6JG | ![]() |
0.276 |