![]() |
Name |
pestalotione B
|
Molecular Formula | C19H18O7 | |
IUPAC Name* |
methyl8-hydroxy-2-(2-hydroxyethyl)-3-methoxy-6-methyl-9-oxoxanthene-1-carboxylate
|
|
SMILES |
COC(=O)c1c(CCO)c(OC)cc2oc3cc(C)cc(O)c3c(=O)c12
|
|
InChI |
InChI=1S/C19H18O7/c1-9-6-11(21)16-13(7-9)26-14-8-12(24-2)10(4-5-20)15(19(23)25-3)17(14)18(16)22/h6-8,20-21H,4-5H2,1-3H3
|
|
InChIKey |
BREPJHIPYLHGIJ-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 358.35 | ALogp: | 2.3 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 106.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.545 |
Caco-2 Permeability: | -4.944 | MDCK Permeability: | 0.00001820 |
Pgp-inhibitor: | 0.043 | Pgp-substrate: | 0.155 |
Human Intestinal Absorption (HIA): | 0.145 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.196 |
Blood-Brain-Barrier Penetration (BBB): | 0.098 | Plasma Protein Binding (PPB): | 84.77% |
Volume Distribution (VD): | 0.969 | Fu: | 15.06% |
CYP1A2-inhibitor: | 0.897 | CYP1A2-substrate: | 0.975 |
CYP2C19-inhibitor: | 0.351 | CYP2C19-substrate: | 0.245 |
CYP2C9-inhibitor: | 0.745 | CYP2C9-substrate: | 0.875 |
CYP2D6-inhibitor: | 0.402 | CYP2D6-substrate: | 0.503 |
CYP3A4-inhibitor: | 0.361 | CYP3A4-substrate: | 0.213 |
Clearance (CL): | 4.242 | Half-life (T1/2): | 0.779 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.172 |
Drug-inuced Liver Injury (DILI): | 0.891 | AMES Toxicity: | 0.323 |
Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.332 |
Skin Sensitization: | 0.355 | Carcinogencity: | 0.015 |
Eye Corrosion: | 0.02 | Eye Irritation: | 0.479 |
Respiratory Toxicity: | 0.234 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003136 | ![]() |
0.634 | D06GCK | ![]() |
0.359 | ||
ENC002197 | ![]() |
0.619 | D0K8KX | ![]() |
0.297 | ||
ENC001749 | ![]() |
0.617 | D0QD1G | ![]() |
0.270 | ||
ENC002462 | ![]() |
0.598 | D0G4KG | ![]() |
0.265 | ||
ENC003814 | ![]() |
0.581 | D04AIT | ![]() |
0.265 | ||
ENC002404 | ![]() |
0.557 | D06FVX | ![]() |
0.263 | ||
ENC002148 | ![]() |
0.541 | D07MGA | ![]() |
0.257 | ||
ENC002523 | ![]() |
0.537 | D0O6KE | ![]() |
0.257 | ||
ENC002106 | ![]() |
0.536 | D0G7IY | ![]() |
0.248 | ||
ENC002668 | ![]() |
0.523 | D06NSS | ![]() |
0.248 |