![]() |
Name |
N-[[(2S,4R)-2-[(4R)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl]-3-methyl-1,3-thiazolidin-4-yl]methyl]acetamide
|
Molecular Formula | C16H21N3O3S | |
IUPAC Name* |
N-[[(2S,4R)-2-[(4R)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl]-3-methyl-1,3-thiazolidin-4-yl]methyl]acetamide
|
|
SMILES |
CC(=O)NC[C@@H]1CS[C@H](N1C)[C@H]2COC(=N2)C3=CC=CC=C3O
|
|
InChI |
InChI=1S/C16H21N3O3S/c1-10(20)17-7-11-9-23-16(19(11)2)13-8-22-15(18-13)12-5-3-4-6-14(12)21/h3-6,11,13,16,21H,7-9H2,1-2H3,(H,17,20)/t11-,13-,16+/m1/s1
|
|
InChIKey |
BPJOIYDCSWLARY-KFNAQCHYSA-N
|
|
Synonyms |
Spoxazomicin B
|
|
CAS | NA | |
PubChem CID | 139583862 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 335.4 | ALogp: | 1.1 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.5 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.872 |
Caco-2 Permeability: | -5.53 | MDCK Permeability: | 0.00000673 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.992 |
Human Intestinal Absorption (HIA): | 0.136 | 20% Bioavailability (F20%): | 0.198 |
30% Bioavailability (F30%): | 0.052 |
Blood-Brain-Barrier Penetration (BBB): | 0.187 | Plasma Protein Binding (PPB): | 24.05% |
Volume Distribution (VD): | 1.357 | Fu: | 69.81% |
CYP1A2-inhibitor: | 0.618 | CYP1A2-substrate: | 0.086 |
CYP2C19-inhibitor: | 0.139 | CYP2C19-substrate: | 0.734 |
CYP2C9-inhibitor: | 0.054 | CYP2C9-substrate: | 0.244 |
CYP2D6-inhibitor: | 0.555 | CYP2D6-substrate: | 0.382 |
CYP3A4-inhibitor: | 0.043 | CYP3A4-substrate: | 0.242 |
Clearance (CL): | 4.892 | Half-life (T1/2): | 0.686 |
hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.842 |
Drug-inuced Liver Injury (DILI): | 0.861 | AMES Toxicity: | 0.071 |
Rat Oral Acute Toxicity: | 0.02 | Maximum Recommended Daily Dose: | 0.416 |
Skin Sensitization: | 0.371 | Carcinogencity: | 0.066 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.028 |
Respiratory Toxicity: | 0.76 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003658 | ![]() |
1.000 | D0J5KF | ![]() |
0.272 | ||
ENC003599 | ![]() |
1.000 | D0G7FJ | ![]() |
0.267 | ||
ENC004727 | ![]() |
0.661 | D04KTZ | ![]() |
0.263 | ||
ENC002684 | ![]() |
0.661 | D07HBX | ![]() |
0.260 | ||
ENC003786 | ![]() |
0.587 | D0R1BD | ![]() |
0.255 | ||
ENC004726 | ![]() |
0.515 | D0RD5W | ![]() |
0.250 | ||
ENC004724 | ![]() |
0.515 | D05ZJG | ![]() |
0.250 | ||
ENC004547 | ![]() |
0.511 | D09CPR | ![]() |
0.248 | ||
ENC004723 | ![]() |
0.493 | D0Z5EM | ![]() |
0.248 | ||
ENC004545 | ![]() |
0.471 | D0K0KH | ![]() |
0.248 |