|
Name |
(1R,4S,5S,7R,10R,11S)-Guaiane-10,11,12-triol
|
Molecular Formula | C15H28O3 | |
IUPAC Name* |
2-(8-hydroxy-3,8-dimethyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulen-5-yl)propane-1,2-diol
|
|
SMILES |
CC1CCC2C1CC(C(C)(O)CO)CCC2(C)O
|
|
InChI |
InChI=1S/C15H28O3/c1-10-4-5-13-12(10)8-11(15(3,18)9-16)6-7-14(13,2)17/h10-13,16-18H,4-9H2,1-3H3/t10-,11+,12-,13+,14+,15+/m0/s1
|
|
InChIKey |
ZMKAVJLNYHOIQP-XWSJDDSLSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 256.39 | ALogp: | 1.9 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 60.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.711 |
Caco-2 Permeability: | -4.535 | MDCK Permeability: | 0.00002070 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.022 |
Blood-Brain-Barrier Penetration (BBB): | 0.954 | Plasma Protein Binding (PPB): | 81.04% |
Volume Distribution (VD): | 0.991 | Fu: | 18.71% |
CYP1A2-inhibitor: | 0.043 | CYP1A2-substrate: | 0.333 |
CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.873 |
CYP2C9-inhibitor: | 0.061 | CYP2C9-substrate: | 0.22 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.205 |
CYP3A4-inhibitor: | 0.065 | CYP3A4-substrate: | 0.384 |
Clearance (CL): | 12.566 | Half-life (T1/2): | 0.492 |
hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.333 |
Drug-inuced Liver Injury (DILI): | 0.095 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.033 |
Skin Sensitization: | 0.129 | Carcinogencity: | 0.037 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.094 |
Respiratory Toxicity: | 0.027 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D07QKN | 0.356 | ||||||
D0N6FH | 0.284 | ||||||
D0S3WH | 0.268 | ||||||
D0Y5ZA | 0.264 | ||||||
D08PIQ | 0.260 | ||||||
D00VZZ | 0.258 | ||||||
D0SC8F | 0.256 | ||||||
D0U3GL | 0.253 | ||||||
D0Q6NZ | 0.253 | ||||||
D0KR5B | 0.253 |