![]() |
Name |
(10S,11R,12E,17E,19E,21S)-21-hydroxy-11,19-dimethyl-10-propan-2-yl-9,26-dioxa-3,15,28-triazatricyclo[23.2.1.03,7]octacosa-1(27),6,12,17,19,25(28)-hexaene-2,8,14,23-tetrone
|
Molecular Formula | C28H35N3O7 | |
IUPAC Name* |
(10S,11R,12E,17E,19E,21S)-21-hydroxy-11,19-dimethyl-10-propan-2-yl-9,26-dioxa-3,15,28-triazatricyclo[23.2.1.03,7]octacosa-1(27),6,12,17,19,25(28)-hexaene-2,8,14,23-tetrone
|
|
SMILES |
C[C@@H]1/C=C/C(=O)NC/C=C/C(=C/[C@H](CC(=O)CC2=NC(=CO2)C(=O)N3CCC=C3C(=O)O[C@H]1C(C)C)O)/C
|
|
InChI |
InChI=1S/C28H35N3O7/c1-17(2)26-19(4)9-10-24(34)29-11-5-7-18(3)13-20(32)14-21(33)15-25-30-22(16-37-25)27(35)31-12-6-8-23(31)28(36)38-26/h5,7-10,13,16-17,19-20,26,32H,6,11-12,14-15H2,1-4H3,(H,29,34)/b7-5+,10-9+,18-13+/t19-,20-,26+/m1/s1
|
|
InChIKey |
DAIKHDNSXMZDCU-WEDBDSGPSA-N
|
|
Synonyms |
virginiamycin m1; DTXSID30873800; 21411-53-0
|
|
CAS | 21411-53-0 | |
PubChem CID | 138394156 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 525.6 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 139.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 38 | QED Weighted: | 0.532 |
Caco-2 Permeability: | -4.79 | MDCK Permeability: | 0.00000582 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.987 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.722 |
Blood-Brain-Barrier Penetration (BBB): | 0.603 | Plasma Protein Binding (PPB): | 75.40% |
Volume Distribution (VD): | 0.577 | Fu: | 29.42% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.076 |
CYP2C19-inhibitor: | 0.065 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.14 | CYP2C9-substrate: | 0.115 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.148 |
CYP3A4-inhibitor: | 0.272 | CYP3A4-substrate: | 0.242 |
Clearance (CL): | 8.861 | Half-life (T1/2): | 0.742 |
hERG Blockers: | 0.045 | Human Hepatotoxicity (H-HT): | 0.667 |
Drug-inuced Liver Injury (DILI): | 0.97 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.544 | Maximum Recommended Daily Dose: | 0.919 |
Skin Sensitization: | 0.259 | Carcinogencity: | 0.896 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.938 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005288 | ![]() |
0.826 | D05AFC | ![]() |
0.616 | ||
ENC005287 | ![]() |
0.778 | D05MNW | ![]() |
0.385 | ||
ENC002429 | ![]() |
0.750 | D07XGH | ![]() |
0.385 | ||
ENC005087 | ![]() |
0.264 | D0L7LC | ![]() |
0.230 | ||
ENC003855 | ![]() |
0.256 | D00TLP | ![]() |
0.220 | ||
ENC002927 | ![]() |
0.248 | D06YFA | ![]() |
0.211 | ||
ENC005850 | ![]() |
0.243 | D03LJR | ![]() |
0.205 | ||
ENC004308 | ![]() |
0.241 | D0V7WS | ![]() |
0.204 | ||
ENC003672 | ![]() |
0.241 | D06WTZ | ![]() |
0.201 | ||
ENC002441 | ![]() |
0.238 | D09NNH | ![]() |
0.201 |