![]() |
Name |
Nigerasperone C
|
Molecular Formula | C31H26O11 | |
IUPAC Name* |
7-(2,5-dihydroxy-6,8-dimethoxy-2-methyl-4-oxo-3H-benzo[g]chromen-10-yl)-4,5-dihydroxy-6-methoxy-2-methylbenzo[g]chromen-8-one
|
|
SMILES |
CC1=CC(=C2C(=CC3=CC(=O)C(=C(C3=C2O)OC)C4=C5C(=C(C6=C4C=C(C=C6OC)OC)O)C(=O)CC(O5)(C)O)O1)O
|
|
InChI |
InChI=1S/C31H26O11/c1-12-6-16(32)24-20(41-12)8-13-7-17(33)25(29(40-5)21(13)27(24)35)23-15-9-14(38-3)10-19(39-4)22(15)28(36)26-18(34)11-31(2,37)42-30(23)26/h6-10,32,35-37H,11H2,1-5H3
|
|
InChIKey |
PIXNRLCOGGHRMO-UHFFFAOYSA-N
|
|
Synonyms |
Nigerasperone C; MLS004256126; SMR003081011; 2',5,5',8-tetrahydroxy-6,6',8'-trimethoxy-2,2'-dimethyl-2'H,4H-[7,10'-bibenzo[g]chromene]-4,4'(3'H)-dione
|
|
CAS | NA | |
PubChem CID | 135540961 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 574.5 | ALogp: | 2.8 |
HBD: | 4 | HBA: | 11 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 161.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 42 | QED Weighted: | 0.207 |
Caco-2 Permeability: | -5.3 | MDCK Permeability: | 0.00001580 |
Pgp-inhibitor: | 0.977 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.647 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.058 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 76.43% |
Volume Distribution (VD): | 0.572 | Fu: | 29.81% |
CYP1A2-inhibitor: | 0.278 | CYP1A2-substrate: | 0.97 |
CYP2C19-inhibitor: | 0.106 | CYP2C19-substrate: | 0.17 |
CYP2C9-inhibitor: | 0.634 | CYP2C9-substrate: | 0.832 |
CYP2D6-inhibitor: | 0.019 | CYP2D6-substrate: | 0.311 |
CYP3A4-inhibitor: | 0.122 | CYP3A4-substrate: | 0.158 |
Clearance (CL): | 2.588 | Half-life (T1/2): | 0.126 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.083 |
Drug-inuced Liver Injury (DILI): | 0.971 | AMES Toxicity: | 0.144 |
Rat Oral Acute Toxicity: | 0.05 | Maximum Recommended Daily Dose: | 0.482 |
Skin Sensitization: | 0.2 | Carcinogencity: | 0.014 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.249 |
Respiratory Toxicity: | 0.061 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005776 | ![]() |
1.000 | D06GCK | ![]() |
0.353 | ||
ENC003149 | ![]() |
0.835 | D0FX2Q | ![]() |
0.259 | ||
ENC005173 | ![]() |
0.811 | D03RTK | ![]() |
0.255 | ||
ENC002884 | ![]() |
0.769 | D0G4KG | ![]() |
0.254 | ||
ENC003048 | ![]() |
0.765 | D04AIT | ![]() |
0.254 | ||
ENC000912 | ![]() |
0.727 | D0K8KX | ![]() |
0.250 | ||
ENC003507 | ![]() |
0.727 | D02LZB | ![]() |
0.250 | ||
ENC000984 | ![]() |
0.713 | D0V8HJ | ![]() |
0.250 | ||
ENC005172 | ![]() |
0.704 | D09DHY | ![]() |
0.250 | ||
ENC000969 | ![]() |
0.693 | D0C1SF | ![]() |
0.250 |