![]() |
Name |
Asperpyrone D
|
Molecular Formula | C31H24O10 | |
IUPAC Name* |
4,5-dihydroxy-7-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxobenzo[h]chromen-6-yl)-6-methoxy-2-methylbenzo[g]chromen-8-one
|
|
SMILES |
CC1=CC(=C2C(=CC3=CC(=O)C(=C(C3=C2O)OC)C4=C(C5=C(C6=C4C=C(C=C6OC)OC)OC(=CC5=O)C)O)O1)O
|
|
InChI |
InChI=1S/C31H24O10/c1-12-6-17(32)25-21(40-12)9-14-8-19(34)26(30(39-5)22(14)28(25)35)24-16-10-15(37-3)11-20(38-4)23(16)31-27(29(24)36)18(33)7-13(2)41-31/h6-11,32,35-36H,1-5H3
|
|
InChIKey |
FXSBCSVDVXVGNP-UHFFFAOYSA-N
|
|
Synonyms |
Asperpyrone D; CHEMBL4874178; 5,8-dihydroxy-7-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxo-benzo[h]chromen-6-yl)-6-methoxy-2-methyl-benzo[g]chromen-4-one
|
|
CAS | NA | |
PubChem CID | 135513373 | |
ChEMBL ID | CHEMBL4874178 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 556.5 | ALogp: | 3.7 |
HBD: | 3 | HBA: | 10 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 141.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 41 | QED Weighted: | 0.18 |
Caco-2 Permeability: | -5.196 | MDCK Permeability: | 0.00001610 |
Pgp-inhibitor: | 0.866 | Pgp-substrate: | 0.104 |
Human Intestinal Absorption (HIA): | 0.69 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.957 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 71.20% |
Volume Distribution (VD): | 0.458 | Fu: | 42.63% |
CYP1A2-inhibitor: | 0.33 | CYP1A2-substrate: | 0.98 |
CYP2C19-inhibitor: | 0.404 | CYP2C19-substrate: | 0.143 |
CYP2C9-inhibitor: | 0.763 | CYP2C9-substrate: | 0.91 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.823 |
CYP3A4-inhibitor: | 0.078 | CYP3A4-substrate: | 0.14 |
Clearance (CL): | 2.543 | Half-life (T1/2): | 0.126 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.136 |
Drug-inuced Liver Injury (DILI): | 0.984 | AMES Toxicity: | 0.136 |
Rat Oral Acute Toxicity: | 0.097 | Maximum Recommended Daily Dose: | 0.929 |
Skin Sensitization: | 0.399 | Carcinogencity: | 0.019 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.71 |
Respiratory Toxicity: | 0.056 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000912 | ![]() |
0.932 | D06GCK | ![]() |
0.368 | ||
ENC001411 | ![]() |
0.837 | D0G4KG | ![]() |
0.297 | ||
ENC002093 | ![]() |
0.832 | D04AIT | ![]() |
0.267 | ||
ENC000922 | ![]() |
0.823 | D06NSS | ![]() |
0.246 | ||
ENC001501 | ![]() |
0.775 | D03RTK | ![]() |
0.245 | ||
ENC003154 | ![]() |
0.735 | D09DHY | ![]() |
0.245 | ||
ENC002002 | ![]() |
0.735 | D02LZB | ![]() |
0.245 | ||
ENC005776 | ![]() |
0.727 | D0K8KX | ![]() |
0.245 | ||
ENC003508 | ![]() |
0.727 | D0FX2Q | ![]() |
0.242 | ||
ENC003592 | ![]() |
0.699 | D0FA2O | ![]() |
0.240 |