|
Name |
Aurasperone F
|
Molecular Formula | C31H26O11 | |
IUPAC Name* |
5-hydroxy-6,8-dimethoxy-2-methyl-10-(2,5,8-trihydroxy-6-methoxy-2-methyl-4-oxo-3H-benzo[g]chromen-7-yl)benzo[g]chromen-4-one
|
|
SMILES |
CC1=CC(=O)C2=C(C3=C(C=C(C=C3OC)OC)C(=C2O1)C4=C(C=C5C=C6C(=C(C5=C4OC)O)C(=O)CC(O6)(C)O)O)O
|
|
InChI |
InChI=1S/C31H26O11/c1-12-6-16(32)26-28(36)22-15(9-14(38-3)10-19(22)39-4)23(30(26)41-12)25-17(33)7-13-8-20-24(18(34)11-31(2,37)42-20)27(35)21(13)29(25)40-5/h6-10,33,35-37H,11H2,1-5H3
|
|
InChIKey |
COAWIYTXRNAXHF-UHFFFAOYSA-N
|
|
Synonyms |
Aurasperone F; Isoaurasperone F; MLS004256128; SCHEMBL21638079; DTXSID001018090; SMR003081013; J3.607.934G; 2,2'-Dimethyl-2,5,5',8-tetrahydroxy-6,6',8'-trimethoxy-2,3-dihydro-7,10'-bi[4H-naphtho[2,3-b]pyran]-4,4'-dione; 5-hydroxy-6,8-dimethoxy-2-methyl-10-(2,5,8-trihydroxy-6-methoxy-2-methyl-4-oxo-3H-benzo[g]chromen-7-yl)benzo[g]chromen-4-one; 876345-06-1
|
|
CAS | 876345-06-1 | |
PubChem CID | 60158905 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 574.5 | ALogp: | 5.1 |
HBD: | 4 | HBA: | 11 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 161.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 42 | QED Weighted: | 0.207 |
Caco-2 Permeability: | -5.303 | MDCK Permeability: | 0.00001870 |
Pgp-inhibitor: | 0.953 | Pgp-substrate: | 0.011 |
Human Intestinal Absorption (HIA): | 0.709 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.199 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 73.60% |
Volume Distribution (VD): | 0.582 | Fu: | 29.94% |
CYP1A2-inhibitor: | 0.285 | CYP1A2-substrate: | 0.972 |
CYP2C19-inhibitor: | 0.101 | CYP2C19-substrate: | 0.137 |
CYP2C9-inhibitor: | 0.608 | CYP2C9-substrate: | 0.83 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.365 |
CYP3A4-inhibitor: | 0.102 | CYP3A4-substrate: | 0.15 |
Clearance (CL): | 4.142 | Half-life (T1/2): | 0.161 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.156 |
Drug-inuced Liver Injury (DILI): | 0.982 | AMES Toxicity: | 0.21 |
Rat Oral Acute Toxicity: | 0.069 | Maximum Recommended Daily Dose: | 0.436 |
Skin Sensitization: | 0.101 | Carcinogencity: | 0.018 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.125 |
Respiratory Toxicity: | 0.097 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000984 | 0.879 | D06GCK | 0.343 | ||||
ENC005172 | 0.870 | D0G4KG | 0.292 | ||||
ENC005173 | 0.825 | D07MGA | 0.266 | ||||
ENC005776 | 0.769 | D0V8HJ | 0.257 | ||||
ENC003508 | 0.769 | D02LZB | 0.250 | ||||
ENC003048 | 0.752 | D09DHY | 0.250 | ||||
ENC003149 | 0.739 | D0D4HN | 0.250 | ||||
ENC000969 | 0.731 | D03RTK | 0.249 | ||||
ENC000912 | 0.689 | D0FX2Q | 0.246 | ||||
ENC001411 | 0.676 | D01XWG | 0.246 |