![]() |
Name |
Asperpyrone A
|
Molecular Formula | C31H24O10 | |
IUPAC Name* |
4,5-dihydroxy-9-(5-hydroxy-6,8-dimethoxy-2-methyl-4-oxobenzo[g]chromen-10-yl)-10-methoxy-2-methylbenzo[h]chromen-8-one
|
|
SMILES |
CC1=CC(=C2C(=CC3=CC(=O)C(=C(C3=C2O1)OC)C4=C5C(=C(C6=C4C=C(C=C6OC)OC)O)C(=O)C=C(O5)C)O)O
|
|
InChI |
InChI=1S/C31H24O10/c1-12-6-17(32)25-19(34)8-14-9-20(35)26(29(39-5)22(14)30(25)40-12)24-16-10-15(37-3)11-21(38-4)23(16)28(36)27-18(33)7-13(2)41-31(24)27/h6-11,32,34,36H,1-5H3
|
|
InChIKey |
URHOXQWBGQQUMQ-UHFFFAOYSA-N
|
|
Synonyms |
Asperpyrone A; (aS)-asperpyrone A; CHEMBL448384; BDBM50539729; 10-(5,8-dihydroxy-10-methoxy-2-methyl-4-oxo-4H-benzo[h]chromen-9-yl)-5-hydroxy-6,8-dimethoxy-2-methyl-4H-benzo[g]chromen-4-one; 10-(5,8-Dihydroxy-10-methoxy-2-methyl-4-oxo-4H-benzo[h]chromen-9-yl)-5-hydroxy-6,8-dimethoxy-2-methyl-benzo[g]chromen-4-one; 4H-naphtho[2,3-b]pyran-4-one, 10-(5,8-dihydroxy-10-methoxy-2-methyl-4-oxo-4H-naphtho[1,2-b]pyran-9-yl)-5-hydroxy-6,8-dimethoxy-2-methyl-; 5,8-dihydroxy-9-(5-hydroxy-6,8-dimethoxy-2-methyl-4-oxo-benzo[g]chromen-10-yl)-10-methoxy-2-methyl-benzo[h]chromen-4-one
|
|
CAS | NA | |
PubChem CID | 637172 | |
ChEMBL ID | CHEMBL448384 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 556.5 | ALogp: | 3.7 |
HBD: | 3 | HBA: | 10 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 141.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 41 | QED Weighted: | 0.18 |
Caco-2 Permeability: | -5.192 | MDCK Permeability: | 0.00001830 |
Pgp-inhibitor: | 0.656 | Pgp-substrate: | 0.12 |
Human Intestinal Absorption (HIA): | 0.728 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.958 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 69.61% |
Volume Distribution (VD): | 0.472 | Fu: | 44.36% |
CYP1A2-inhibitor: | 0.373 | CYP1A2-substrate: | 0.981 |
CYP2C19-inhibitor: | 0.387 | CYP2C19-substrate: | 0.104 |
CYP2C9-inhibitor: | 0.711 | CYP2C9-substrate: | 0.914 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.748 |
CYP3A4-inhibitor: | 0.07 | CYP3A4-substrate: | 0.138 |
Clearance (CL): | 3.317 | Half-life (T1/2): | 0.154 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.244 |
Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.185 |
Rat Oral Acute Toxicity: | 0.169 | Maximum Recommended Daily Dose: | 0.939 |
Skin Sensitization: | 0.184 | Carcinogencity: | 0.019 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.602 |
Respiratory Toxicity: | 0.062 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000912 | ![]() |
0.868 | D06GCK | ![]() |
0.348 | ||
ENC003507 | ![]() |
0.837 | D0G4KG | ![]() |
0.307 | ||
ENC002002 | ![]() |
0.832 | D04AIT | ![]() |
0.257 | ||
ENC000922 | ![]() |
0.766 | D0FA2O | ![]() |
0.250 | ||
ENC003592 | ![]() |
0.752 | D03RTK | ![]() |
0.245 | ||
ENC001501 | ![]() |
0.735 | D09DHY | ![]() |
0.245 | ||
ENC002093 | ![]() |
0.709 | D02LZB | ![]() |
0.245 | ||
ENC003154 | ![]() |
0.684 | D07MGA | ![]() |
0.243 | ||
ENC005173 | ![]() |
0.676 | D06NSS | ![]() |
0.238 | ||
ENC002884 | ![]() |
0.676 | D0D4HN | ![]() |
0.238 |