![]() |
Name |
7-Acetoxycytochalasin H
|
Molecular Formula | C32H41NO6 | |
IUPAC Name* |
[(1R,2R,3E,5R,7S,9E,11R,12S,14S,15R,16S)-12-acetyloxy-16-benzyl-5-hydroxy-5,7,14-trimethyl-13-methylidene-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-2-yl] acetate
|
|
SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H](C(=C)[C@H]([C@@H]3[C@@]2([C@@H](/C=C/[C@](C1)(C)O)OC(=O)C)C(=O)N[C@H]3CC4=CC=CC=C4)C)OC(=O)C
|
|
InChI |
InChI=1S/C32H41NO6/c1-19-11-10-14-25-29(39-23(5)35)21(3)20(2)28-26(17-24-12-8-7-9-13-24)33-30(36)32(25,28)27(38-22(4)34)15-16-31(6,37)18-19/h7-10,12-16,19-20,25-29,37H,3,11,17-18H2,1-2,4-6H3,(H,33,36)/b14-10+,16-15+/t19-,20+,25-,26-,27+,28-,29+,31-,32+/m0/s1
|
|
InChIKey |
QTMFSRBHTRHUHE-MPMZSRJWSA-N
|
|
Synonyms |
7-Acetoxycytochalasin H; Acetylcytochalasin H; 9PC6YB8658; 84499-89-8; (11)Cytochalasa-6(12),13,19-trien-1-one, 7,21-bis(acetyloxy)-18-hydroxy-16,18-dimethyl-10-phenyl-, (7S,13E,16S,18R,19E,21R)-; UNII-9PC6YB8658; DTXSID101338809
|
|
CAS | 84499-89-8 | |
PubChem CID | 123133447 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 535.7 | ALogp: | 4.0 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 102.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 39 | QED Weighted: | 0.422 |
Caco-2 Permeability: | -5.402 | MDCK Permeability: | 0.00002040 |
Pgp-inhibitor: | 0.607 | Pgp-substrate: | 0.63 |
Human Intestinal Absorption (HIA): | 0.6 | 20% Bioavailability (F20%): | 0.022 |
30% Bioavailability (F30%): | 0.065 |
Blood-Brain-Barrier Penetration (BBB): | 0.183 | Plasma Protein Binding (PPB): | 75.62% |
Volume Distribution (VD): | 1.04 | Fu: | 11.68% |
CYP1A2-inhibitor: | 0.033 | CYP1A2-substrate: | 0.086 |
CYP2C19-inhibitor: | 0.793 | CYP2C19-substrate: | 0.507 |
CYP2C9-inhibitor: | 0.74 | CYP2C9-substrate: | 0.085 |
CYP2D6-inhibitor: | 0.048 | CYP2D6-substrate: | 0.069 |
CYP3A4-inhibitor: | 0.919 | CYP3A4-substrate: | 0.298 |
Clearance (CL): | 2.321 | Half-life (T1/2): | 0.155 |
hERG Blockers: | 0.046 | Human Hepatotoxicity (H-HT): | 0.9 |
Drug-inuced Liver Injury (DILI): | 0.916 | AMES Toxicity: | 0.028 |
Rat Oral Acute Toxicity: | 0.84 | Maximum Recommended Daily Dose: | 0.982 |
Skin Sensitization: | 0.114 | Carcinogencity: | 0.027 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004468 | ![]() |
0.823 | D06CWH | ![]() |
0.280 | ||
ENC001922 | ![]() |
0.729 | D0R1BD | ![]() |
0.259 | ||
ENC002762 | ![]() |
0.725 | D0V3ZA | ![]() |
0.257 | ||
ENC002261 | ![]() |
0.719 | D0C4RB | ![]() |
0.252 | ||
ENC003653 | ![]() |
0.719 | D0D7KC | ![]() |
0.252 | ||
ENC004026 | ![]() |
0.691 | D0O5WP | ![]() |
0.251 | ||
ENC002763 | ![]() |
0.675 | D0SP3D | ![]() |
0.250 | ||
ENC004243 | ![]() |
0.664 | D01TSI | ![]() |
0.250 | ||
ENC005133 | ![]() |
0.651 | D07HOF | ![]() |
0.250 | ||
ENC004745 | ![]() |
0.635 | D09NNH | ![]() |
0.250 |