![]() |
Name |
Secopenitrem D
|
Molecular Formula | C37H47NO4 | |
IUPAC Name* |
(2S,3R,6S,8R,9R,12S,15S,20S,21S,23S)-21-(2-hydroxypropan-2-yl)-2,3-dimethyl-24-methylidene-8-prop-1-en-2-yl-7-oxa-30-azaoctacyclo[15.13.0.02,15.03,12.06,11.018,29.019,26.020,23]triaconta-1(17),10,18(29),19(26),27-pentaene-9,12-diol
|
|
SMILES |
CC(=C)[C@@H]1[C@@H](C=C2[C@@H](O1)CC[C@]3([C@]2(CC[C@@H]4[C@@]3(C5=C(C4)C6=C(N5)C=CC7=C6[C@H]8[C@H](C[C@@H]8C(C)(C)O)C(=C)C7)C)O)C)O
|
|
InChI |
InChI=1S/C37H47NO4/c1-18(2)32-27(39)17-24-28(42-32)11-12-35(6)36(7)21(10-13-37(24,35)41)15-23-31-26(38-33(23)36)9-8-20-14-19(3)22-16-25(34(4,5)40)30(22)29(20)31/h8-9,17,21-22,25,27-28,30,32,38-41H,1,3,10-16H2,2,4-7H3/t21-,22+,25-,27+,28-,30-,32+,35+,36+,37+/m0/s1
|
|
InChIKey |
YZQRMJFPWMHAJV-ZBPZTRHESA-N
|
|
Synonyms |
Secopenitrem D; CHEMBL3928169
|
|
CAS | NA | |
PubChem CID | 122394031 | |
ChEMBL ID | CHEMBL3928169 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 569.8 | ALogp: | 4.8 |
HBD: | 4 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 85.7 | Aromatic Rings: | 8 |
Heavy Atoms: | 42 | QED Weighted: | 0.325 |
Caco-2 Permeability: | -5.281 | MDCK Permeability: | 0.00000970 |
Pgp-inhibitor: | 0.96 | Pgp-substrate: | 0.885 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.941 |
30% Bioavailability (F30%): | 0.018 |
Blood-Brain-Barrier Penetration (BBB): | 0.852 | Plasma Protein Binding (PPB): | 86.00% |
Volume Distribution (VD): | 2.015 | Fu: | 6.71% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.928 |
CYP2C19-inhibitor: | 0.212 | CYP2C19-substrate: | 0.661 |
CYP2C9-inhibitor: | 0.338 | CYP2C9-substrate: | 0.091 |
CYP2D6-inhibitor: | 0.073 | CYP2D6-substrate: | 0.174 |
CYP3A4-inhibitor: | 0.853 | CYP3A4-substrate: | 0.906 |
Clearance (CL): | 7.336 | Half-life (T1/2): | 0.009 |
hERG Blockers: | 0.819 | Human Hepatotoxicity (H-HT): | 0.242 |
Drug-inuced Liver Injury (DILI): | 0.139 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.988 | Maximum Recommended Daily Dose: | 0.967 |
Skin Sensitization: | 0.117 | Carcinogencity: | 0.948 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.991 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003329 | ![]() |
0.763 | D06AWE | ![]() |
0.243 | ||
ENC001486 | ![]() |
0.676 | D0H2JP | ![]() |
0.243 | ||
ENC003833 | ![]() |
0.579 | D02IQY | ![]() |
0.230 | ||
ENC003453 | ![]() |
0.567 | D05VIL | ![]() |
0.230 | ||
ENC001499 | ![]() |
0.484 | D06AEO | ![]() |
0.222 | ||
ENC003832 | ![]() |
0.478 | D0I2SD | ![]() |
0.219 | ||
ENC000836 | ![]() |
0.475 | D01KQA | ![]() |
0.218 | ||
ENC003660 | ![]() |
0.460 | D06YFA | ![]() |
0.218 | ||
ENC001492 | ![]() |
0.449 | D0Z1FX | ![]() |
0.215 | ||
ENC001508 | ![]() |
0.434 | D0T2PL | ![]() |
0.215 |