![]() |
Name |
Rhytidenone F
|
Molecular Formula | C20H16O4 | |
IUPAC Name* |
(4'R,4'aS)-4'-hydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,5'-4,4a,6,7-tetrahydronaphthalene]-1'-one
|
|
SMILES |
C1CC2([C@@H]3[C@@H](C=CC(=O)C3=C1)O)OC4=CC=CC5=C4C(=CC=C5)O2
|
|
InChI |
InChI=1S/C20H16O4/c21-14-9-10-15(22)19-13(14)6-3-11-20(19)23-16-7-1-4-12-5-2-8-17(24-20)18(12)16/h1-2,4-10,15,19,22H,3,11H2/t15-,19+/m1/s1
|
|
InChIKey |
XWCLVXNOOJTGEV-BEFAXECRSA-N
|
|
Synonyms |
Rhytidenone F; CHEMBL3325621; J3.631.168A; (8'R)-8'beta-Hydroxy-8',8'aalpha-dihydrospiro[naphtho[1,8-de]-1,3-dioxin-2,1'(2'H)-naphthalene]-5'(3'H)-one
|
|
CAS | NA | |
PubChem CID | 118711060 | |
ChEMBL ID | CHEMBL3325621 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 320.3 | ALogp: | 3.1 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 5 |
Heavy Atoms: | 24 | QED Weighted: | 0.799 |
Caco-2 Permeability: | -4.99 | MDCK Permeability: | 0.00001690 |
Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.049 |
30% Bioavailability (F30%): | 0.034 |
Blood-Brain-Barrier Penetration (BBB): | 0.113 | Plasma Protein Binding (PPB): | 98.58% |
Volume Distribution (VD): | 1.014 | Fu: | 0.92% |
CYP1A2-inhibitor: | 0.925 | CYP1A2-substrate: | 0.501 |
CYP2C19-inhibitor: | 0.928 | CYP2C19-substrate: | 0.077 |
CYP2C9-inhibitor: | 0.877 | CYP2C9-substrate: | 0.946 |
CYP2D6-inhibitor: | 0.797 | CYP2D6-substrate: | 0.855 |
CYP3A4-inhibitor: | 0.554 | CYP3A4-substrate: | 0.28 |
Clearance (CL): | 7.632 | Half-life (T1/2): | 0.83 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.227 |
Drug-inuced Liver Injury (DILI): | 0.404 | AMES Toxicity: | 0.891 |
Rat Oral Acute Toxicity: | 0.721 | Maximum Recommended Daily Dose: | 0.177 |
Skin Sensitization: | 0.934 | Carcinogencity: | 0.936 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.907 |
Respiratory Toxicity: | 0.869 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003642 | ![]() |
0.707 | D08CCE | ![]() |
0.275 | ||
ENC003287 | ![]() |
0.690 | D06TJJ | ![]() |
0.268 | ||
ENC003288 | ![]() |
0.690 | D00JRA | ![]() |
0.255 | ||
ENC003289 | ![]() |
0.667 | D09LDR | ![]() |
0.245 | ||
ENC005581 | ![]() |
0.667 | D0O6IZ | ![]() |
0.242 | ||
ENC003563 | ![]() |
0.542 | D04BNP | ![]() |
0.240 | ||
ENC003442 | ![]() |
0.527 | D08FTG | ![]() |
0.240 | ||
ENC002531 | ![]() |
0.527 | D0QV5T | ![]() |
0.238 | ||
ENC001972 | ![]() |
0.527 | D05VLS | ![]() |
0.234 | ||
ENC003417 | ![]() |
0.511 | D05MQK | ![]() |
0.232 |