![]() |
Name |
Palmarumycin CP18
|
Molecular Formula | C20H14O5 | |
IUPAC Name* |
(5'S)-5'-hydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-6,7-dihydro-5H-naphthalene]-1',4'-dione
|
|
SMILES |
C1CC2(C3=C([C@H]1O)C(=O)C=CC3=O)OC4=CC=CC5=C4C(=CC=C5)O2
|
|
InChI |
InChI=1S/C20H14O5/c21-12-7-8-14(23)19-18(12)13(22)9-10-20(19)24-15-5-1-3-11-4-2-6-16(25-20)17(11)15/h1-8,13,22H,9-10H2/t13-/m0/s1
|
|
InChIKey |
QRNNOWVUVIEQSM-ZDUSSCGKSA-N
|
|
Synonyms |
Palmarumycin CP18; CHEMBL457642; (5'S)-5'-Hydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-6,7-dihydro-5H-naphthalene]-1',4'-dione
|
|
CAS | NA | |
PubChem CID | 25147587 | |
ChEMBL ID | CHEMBL457642 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 334.3 | ALogp: | 2.1 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.8 | Aromatic Rings: | 5 |
Heavy Atoms: | 25 | QED Weighted: | 0.749 |
Caco-2 Permeability: | -4.909 | MDCK Permeability: | 0.00001990 |
Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.029 |
30% Bioavailability (F30%): | 0.106 |
Blood-Brain-Barrier Penetration (BBB): | 0.067 | Plasma Protein Binding (PPB): | 97.94% |
Volume Distribution (VD): | 0.586 | Fu: | 1.19% |
CYP1A2-inhibitor: | 0.933 | CYP1A2-substrate: | 0.2 |
CYP2C19-inhibitor: | 0.901 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.884 | CYP2C9-substrate: | 0.929 |
CYP2D6-inhibitor: | 0.832 | CYP2D6-substrate: | 0.405 |
CYP3A4-inhibitor: | 0.715 | CYP3A4-substrate: | 0.221 |
Clearance (CL): | 6.956 | Half-life (T1/2): | 0.777 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.253 |
Drug-inuced Liver Injury (DILI): | 0.953 | AMES Toxicity: | 0.942 |
Rat Oral Acute Toxicity: | 0.882 | Maximum Recommended Daily Dose: | 0.071 |
Skin Sensitization: | 0.908 | Carcinogencity: | 0.943 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.893 |
Respiratory Toxicity: | 0.841 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005582 | ![]() |
0.596 | D06ZEE | ![]() |
0.281 | ||
ENC001112 | ![]() |
0.596 | D06TJJ | ![]() |
0.274 | ||
ENC001956 | ![]() |
0.543 | D08CCE | ![]() |
0.269 | ||
ENC001972 | ![]() |
0.532 | D05MQK | ![]() |
0.258 | ||
ENC003199 | ![]() |
0.532 | D02TJS | ![]() |
0.254 | ||
ENC002530 | ![]() |
0.532 | D09WKB | ![]() |
0.248 | ||
ENC003290 | ![]() |
0.527 | D08FTG | ![]() |
0.247 | ||
ENC005583 | ![]() |
0.526 | D09LDR | ![]() |
0.240 | ||
ENC005524 | ![]() |
0.526 | D00JRA | ![]() |
0.238 | ||
ENC002537 | ![]() |
0.516 | D0O6IZ | ![]() |
0.237 |