![]() |
Name |
Rhytidenone A
|
Molecular Formula | C26H24O7 | |
IUPAC Name* |
NA
|
|
SMILES |
C[C@@H]1[C@]2(CCC(=O)O2)[C@@H]3[C@H](O1)[C@H]([C@@H]4C(=CCCC45OC6=CC=CC7=C6C(=CC=C7)O5)C3=O)O
|
|
InChI |
InChI=1S/C26H24O7/c1-13-25(12-10-18(27)33-25)21-22(28)15-7-4-11-26(20(15)23(29)24(21)30-13)31-16-8-2-5-14-6-3-9-17(32-26)19(14)16/h2-3,5-9,13,20-21,23-24,29H,4,10-12H2,1H3/t13-,20+,21+,23+,24+,25-/m1/s1
|
|
InChIKey |
OWOYIAIIPDKQQG-ISHZGQMXSA-N
|
|
Synonyms |
Rhytidenone A
|
|
CAS | NA | |
PubChem CID | 139043988 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 448.5 | ALogp: | 2.8 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 91.3 | Aromatic Rings: | 7 |
Heavy Atoms: | 33 | QED Weighted: | 0.612 |
Caco-2 Permeability: | -4.891 | MDCK Permeability: | 0.00003960 |
Pgp-inhibitor: | 0.944 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.069 |
30% Bioavailability (F30%): | 0.949 |
Blood-Brain-Barrier Penetration (BBB): | 0.499 | Plasma Protein Binding (PPB): | 94.96% |
Volume Distribution (VD): | 1.175 | Fu: | 2.92% |
CYP1A2-inhibitor: | 0.316 | CYP1A2-substrate: | 0.103 |
CYP2C19-inhibitor: | 0.66 | CYP2C19-substrate: | 0.168 |
CYP2C9-inhibitor: | 0.599 | CYP2C9-substrate: | 0.122 |
CYP2D6-inhibitor: | 0.184 | CYP2D6-substrate: | 0.158 |
CYP3A4-inhibitor: | 0.767 | CYP3A4-substrate: | 0.36 |
Clearance (CL): | 14.816 | Half-life (T1/2): | 0.103 |
hERG Blockers: | 0.637 | Human Hepatotoxicity (H-HT): | 0.897 |
Drug-inuced Liver Injury (DILI): | 0.157 | AMES Toxicity: | 0.494 |
Rat Oral Acute Toxicity: | 0.935 | Maximum Recommended Daily Dose: | 0.848 |
Skin Sensitization: | 0.377 | Carcinogencity: | 0.595 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.017 |
Respiratory Toxicity: | 0.983 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003287 | ![]() |
0.590 | D05MQK | ![]() |
0.234 | ||
ENC003288 | ![]() |
0.590 | D01TSI | ![]() |
0.225 | ||
ENC003289 | ![]() |
0.589 | D0V3ZA | ![]() |
0.225 | ||
ENC003642 | ![]() |
0.587 | D06ZEE | ![]() |
0.225 | ||
ENC005581 | ![]() |
0.557 | D01XDL | ![]() |
0.222 | ||
ENC003290 | ![]() |
0.542 | D08CCE | ![]() |
0.220 | ||
ENC003411 | ![]() |
0.478 | D09NNH | ![]() |
0.219 | ||
ENC003412 | ![]() |
0.474 | D00JRA | ![]() |
0.214 | ||
ENC003415 | ![]() |
0.474 | D0SP3D | ![]() |
0.213 | ||
ENC003413 | ![]() |
0.474 | D09WKB | ![]() |
0.211 |