![]() |
Name |
2-[(1S,2S,3R,7S)-6,8-dimethyl-3-tricyclo[4.4.0.02,7]dec-8-enyl]propan-2-ol
|
Molecular Formula | C15H24O | |
IUPAC Name* |
2-[(1S,2S,3R,7S)-6,8-dimethyl-3-tricyclo[4.4.0.02,7]dec-8-enyl]propan-2-ol
|
|
SMILES |
CC1=CC[C@H]2[C@H]3[C@@H]1C2(CC[C@H]3C(C)(C)O)C
|
|
InChI |
InChI=1S/C15H24O/c1-9-5-6-11-12-10(14(2,3)16)7-8-15(11,4)13(9)12/h5,10-13,16H,6-8H2,1-4H3/t10-,11+,12+,13-,15?/m1/s1
|
|
InChIKey |
IKIHFZGZEWTHEQ-JZQBXTLISA-N
|
|
Synonyms |
alpha-Copaen-11-ol; 41370-56-3
|
|
CAS | NA | |
PubChem CID | 101281096 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 220.35 | ALogp: | 2.9 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 16 | QED Weighted: | 0.658 |
Caco-2 Permeability: | -4.326 | MDCK Permeability: | 0.00001940 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.641 |
30% Bioavailability (F30%): | 0.295 |
Blood-Brain-Barrier Penetration (BBB): | 0.063 | Plasma Protein Binding (PPB): | 86.32% |
Volume Distribution (VD): | 0.945 | Fu: | 13.76% |
CYP1A2-inhibitor: | 0.343 | CYP1A2-substrate: | 0.329 |
CYP2C19-inhibitor: | 0.066 | CYP2C19-substrate: | 0.863 |
CYP2C9-inhibitor: | 0.092 | CYP2C9-substrate: | 0.217 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.448 |
CYP3A4-inhibitor: | 0.106 | CYP3A4-substrate: | 0.28 |
Clearance (CL): | 13.334 | Half-life (T1/2): | 0.312 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.274 |
Drug-inuced Liver Injury (DILI): | 0.063 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.518 | Maximum Recommended Daily Dose: | 0.068 |
Skin Sensitization: | 0.42 | Carcinogencity: | 0.082 |
Eye Corrosion: | 0.903 | Eye Irritation: | 0.618 |
Respiratory Toxicity: | 0.946 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000535 | ![]() |
0.615 | D07QKN | ![]() |
0.293 | ||
ENC004617 | ![]() |
0.571 | D0B4RU | ![]() |
0.259 | ||
ENC004621 | ![]() |
0.552 | D0A2AJ | ![]() |
0.257 | ||
ENC006100 | ![]() |
0.544 | D08IWD | ![]() |
0.245 | ||
ENC002248 | ![]() |
0.517 | D0K0EK | ![]() |
0.229 | ||
ENC004616 | ![]() |
0.492 | D06XMU | ![]() |
0.229 | ||
ENC003367 | ![]() |
0.455 | D0W5LS | ![]() |
0.225 | ||
ENC004620 | ![]() |
0.443 | D0Y7LD | ![]() |
0.223 | ||
ENC003269 | ![]() |
0.435 | D04SFH | ![]() |
0.220 | ||
ENC004619 | ![]() |
0.419 | D00YWP | ![]() |
0.220 |