![]() |
Name |
Fusanoid A
|
Molecular Formula | C15H26O2 | |
IUPAC Name* |
1-(2-hydroxypropan-2-yl)-3a,6-dimethyl-2,3,4,7,8,8a-hexahydro-1H-azulen-4-ol
|
|
SMILES |
CC1=CC(O)C2(C)CCC(C(C)(C)O)C2CC1
|
|
InChI |
InChI=1S/C15H26O2/c1-10-5-6-12-11(14(2,3)17)7-8-15(12,4)13(16)9-10/h9,11-13,16-17H,5-8H2,1-4H3/t11-,12-,13-,15-/m1/s1
|
|
InChIKey |
VGQSWVOEIFXCBK-RGCMKSIDSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 238.37 | ALogp: | 2.9 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.684 |
Caco-2 Permeability: | -4.446 | MDCK Permeability: | 0.00001640 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.234 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.834 | Plasma Protein Binding (PPB): | 92.05% |
Volume Distribution (VD): | 0.753 | Fu: | 8.84% |
CYP1A2-inhibitor: | 0.078 | CYP1A2-substrate: | 0.354 |
CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.864 |
CYP2C9-inhibitor: | 0.139 | CYP2C9-substrate: | 0.857 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.404 |
CYP3A4-inhibitor: | 0.024 | CYP3A4-substrate: | 0.224 |
Clearance (CL): | 7.916 | Half-life (T1/2): | 0.257 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.266 |
Drug-inuced Liver Injury (DILI): | 0.057 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.107 | Maximum Recommended Daily Dose: | 0.14 |
Skin Sensitization: | 0.071 | Carcinogencity: | 0.048 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.048 |
Respiratory Toxicity: | 0.06 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004620 | ![]() |
0.607 | D07QKN | ![]() |
0.351 | ||
ENC004619 | ![]() |
0.579 | D08QMX | ![]() |
0.275 | ||
ENC004621 | ![]() |
0.533 | D06XMU | ![]() |
0.268 | ||
ENC004617 | ![]() |
0.525 | D0Z1FX | ![]() |
0.268 | ||
ENC004622 | ![]() |
0.525 | D0L2LS | ![]() |
0.264 | ||
ENC003142 | ![]() |
0.492 | D02VPX | ![]() |
0.263 | ||
ENC002248 | ![]() |
0.475 | D00YWP | ![]() |
0.259 | ||
ENC004618 | ![]() |
0.452 | D05BTM | ![]() |
0.257 | ||
ENC003269 | ![]() |
0.444 | D0N1TP | ![]() |
0.257 | ||
ENC002017 | ![]() |
0.443 | D02ZGI | ![]() |
0.257 |